Skip to content

Chemistry - Energetics / Thermochemistry

Enthalpy (HH): The heat content of a system at constant pressure. It is a state function.

Enthalpy change (ΔH\Delta H): The heat exchanged with the surroundings during a process at Constant pressure.

ΔH=HproductsHreactants\Delta H = H_{\mathrm{products}} - H_{\mathrm{reactants}}

Exothermic: ΔH<0\Delta H \lt 0. Heat is released to the surroundings. The products have less Enthalpy than the reactants.

Examples: combustion, neutralisation, respiration.

Endothermic: ΔH>0\Delta H \gt 0. Heat is absorbed from the surroundings. The products have more Enthalpy than the reactants.

Examples: thermal decomposition, photosynthesis, dissolving NH4NO3\mathrm{NH}_4\mathrm{NO}_3 in water.

Standard enthalpy changes are measured under standard conditions:

  • Pressure: 1atm1 \mathrm{ atm} (101.3kPa101.3 \mathrm{ kPa})
  • Concentration: 1mol/dm31 \mathrm{ mol/dm}^3 for solutions
  • Temperature: 25C25^\circ\mathrm{C} (298K298 \mathrm{ K})
  • All substances in their standard states

The standard state is the pure substance at 1 atm and the specified temperature.


Standard Enthalpy of Formation (ΔHf\Delta H_f^\circ)

Section titled “Standard Enthalpy of Formation (ΔHf∘\Delta H_f^\circΔHf∘​)”

The enthalpy change when 1 mole of a compound is formed from its elements in their standard states Under standard conditions.

C(s)+O2(g)CO2(g)ΔHf=393.5kJ/mol\mathrm{C}_{(s)} + \mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} \quad \Delta H_f^\circ = -393.5 \mathrm{ kJ/mol}

By definition, ΔHf\Delta H_f^\circ of any element in its standard state = 0.

ΔHf(C(s,graphite))=0;ΔHf(H2(g))=0\Delta H_f^\circ(\mathrm{C}_{(s,\mathrm{ graphite})}) = 0 \quad ; \quad \Delta H_f^\circ(\mathrm{H}_{2(g)}) = 0

Caution: Warning Involves formation FROM elements, not the other way around.

Standard Enthalpy of Combustion (ΔHc\Delta H_c^\circ)

Section titled “Standard Enthalpy of Combustion (ΔHc∘\Delta H_c^\circΔHc∘​)”

The enthalpy change when 1 mole of a substance is completely burned in excess oxygen under standard Conditions.

CH4(g)+2O2(g)CO2(g)+2H2O(l)ΔHc=890.3kJ/mol\mathrm{CH}_{4(g)} + 2\mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} + 2\mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_c^\circ = -890.3 \mathrm{ kJ/mol}

Combustion is always exothermic, so ΔHc<0\Delta H_c^\circ \lt 0.

Standard Enthalpy of Neutralisation (ΔHneut\Delta H_{\mathrm{neut}}^\circ)

Section titled “Standard Enthalpy of Neutralisation (ΔHneut∘\Delta H_{\mathrm{neut}}^\circΔHneut∘​)”

The enthalpy change when 1 mole of water is formed from the reaction between an acid and an alkali Under standard conditions.

H(aq)++OH(aq)H2O(l)ΔHneut=57.3kJ/mol\mathrm{H}^+_{(aq)} + \mathrm{OH}^-_{(aq)} \to \mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_{\mathrm{neut}}^\circ = -57.3 \mathrm{ kJ/mol}

For strong acid-strong base reactions, ΔHneut\Delta H_{\mathrm{neut}}^\circ is approximately constant at 57.3kJ/mol-57.3 \mathrm{ kJ/mol} because the net ionic equation is always the same.

For weak acid-strong base reactions, ΔHneut\Delta H_{\mathrm{neut}}^\circ is less exothermic (less Negative) because energy is absorbed to dissociate the weak acid.

Standard Enthalpy of Atomisation (ΔHat\Delta H_{\mathrm{at}}^\circ)

Section titled “Standard Enthalpy of Atomisation (ΔHat∘\Delta H_{\mathrm{at}}^\circΔHat∘​)”

The enthalpy change to form 1 mole of gaseous atoms from the element in its standard state.

12Cl2(g)Cl(g)ΔHat=+122kJ/mol\frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{Cl}_{(g)} \quad \Delta H_{\mathrm{at}}^\circ = +122 \mathrm{ kJ/mol}

This is always endothermic (bonds must be broken).

SubstanceΔHf\Delta H_f^\circ (kJ/mol)ΔHc\Delta H_c^\circ (kJ/mol)
CO2(g)\mathrm{CO}_{2(g)}393.5-393.5
H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}285.8-285.8
H2O(g)\mathrm{H}_2\mathrm{O}_{(g)}241.8-241.8
CH4(g)\mathrm{CH}_{4(g)}74.8-74.8890.3-890.3
C2H5OH(l)\mathrm{C}_2\mathrm{H}_{5}\mathrm{OH}_{(l)}277.7-277.71367-1367
C3H8(g)\mathrm{C}_3\mathrm{H}_{8(g)}103.8-103.82220-2220
NH3(g)\mathrm{NH}_{3(g)}46.0-46.0383-383
NaOH(aq)\mathrm{NaOH}_{(aq)}470.1-470.1

Hess’s Law states that the enthalpy change for a reaction is the same regardless of the route taken From reactants to products, provided the initial and final conditions are the same.

This is a consequence of enthalpy being a state function.

Using Enthalpies of Formation:

ΔHreaction=ΔHf(products)ΔHf(reactants)\Delta H_{\mathrm{reaction}} = \sum \Delta H_f^\circ(\mathrm{products}) - \sum \Delta H_f^\circ(\mathrm{reactants})

Using Enthalpies of Combustion:

ΔHreaction=ΔHc(reactants)ΔHc(products)\Delta H_{\mathrm{reaction}} = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})

Note the reversal of signs compared to formation.

Worked example 1: Calculate ΔH\Delta H for the reaction:

C3H8(g)+5O2(g)3CO2(g)+4H2O(l)\mathrm{C}_{3\mathrm{H}_{8(g)}} + 5\mathrm{O}_{2(g)} \to 3\mathrm{CO}_{2(g)} + 4\mathrm{H}_2\mathrm{O}_{(l)}

Given: ΔHc(C3H8(g))=2220kJ/mol\Delta H_c^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}}) = -2220 \mathrm{ kJ/mol} ΔHc(CO2(g))=0\Delta H_c^\circ(\mathrm{CO}_{2(g)}) = 0 (it is already fully oxidised), ΔHc(H2O(l))=0\Delta H_c^\circ(\mathrm{H}_2\mathrm{O}_{(l)}) = 0.

Answer

Since CO2\mathrm{CO}_2 and H2O\mathrm{H}_2\mathrm{O} are already combustion products, their ΔHc=0\Delta H_c^\circ = 0.

ΔH=ΔHc(C3H8)[3ΔHc(CO2)+4ΔHc(H2O)]\Delta H = \Delta H_c^\circ(\mathrm{C}_3\mathrm{H}_8) - [3\Delta H_c^\circ(\mathrm{CO}_2) + 4\Delta H_c^\circ(\mathrm{H}_2\mathrm{O})] =2220[3(0)+4(0)]=2220kJ/mol= -2220 - [3(0) + 4(0)] = -2220 \mathrm{ kJ/mol}

This makes sense: the enthalpy of combustion of propane equals the enthalpy change of its combustion Reaction.

Worked example 2: Calculate ΔHf\Delta H_f^\circ of ethanol given:

C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔH=1367kJ/mol\mathrm{C}_2\mathrm{H}_{5}\mathrm{OH}_{(l)} + 3\mathrm{O}_{2(g)} \to 2\mathrm{CO}_{2(g)} + 3\mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H = -1367 \mathrm{ kJ/mol}

ΔHf(CO2(g))=393.5kJ/mol\Delta H_f^\circ(\mathrm{CO}_{2(g)}) = -393.5 \mathrm{ kJ/mol} ΔHf(H2O(l))=285.8kJ/mol\Delta H_f^\circ(\mathrm{H}_2\mathrm{O}_{(l)}) = -285.8 \mathrm{ kJ/mol}

Answer

Using ΔH=ΔHf(products)ΔHf(reactants)\Delta H = \sum \Delta H_f^\circ(\mathrm{products}) - \sum \Delta H_f^\circ(\mathrm{reactants}):

1367=[2(393.5)+3(285.8)][ΔHf(C2H5OH)+3(0)]-1367 = [2(-393.5) + 3(-285.8)] - [\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) + 3(0)]

1367=[787.0+(857.4)]ΔHf(C2H5OH)-1367 = [-787.0 + (-857.4)] - \Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH})

1367=1644.4ΔHf(C2H5OH)-1367 = -1644.4 - \Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH})

ΔHf(C2H5OH)=1644.4+1367=277.4kJ/mol\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) = -1644.4 + 1367 = -277.4 \mathrm{ kJ/mol}

This agrees with the accepted value of 277.7kJ/mol-277.7 \mathrm{ kJ/mol}.

Worked example 3: Using enthalpies of combustion, calculate ΔH\Delta H for:

3C(s)+4H2(g)C3H8(g)3\mathrm{C}_{(s)} + 4\mathrm{H}_{2(g)} \to \mathrm{C}_3\mathrm{H}_{8(g)}

Given: ΔHc(C(s))=393.5kJ/mol\Delta H_c^\circ(\mathrm{C}_{(s)}) = -393.5 \mathrm{ kJ/mol} (same as ΔHc(CO2)\Delta H_c^\circ(\mathrm{CO}_2) since combustion of C gives CO2\mathrm{CO}_2), ΔHc(H2(g))=285.8kJ/mol\Delta H_c^\circ(\mathrm{H}_{2(g)}) = -285.8 \mathrm{ kJ/mol} (gives H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}), ΔHc(C3H8(g))=2220kJ/mol\Delta H_c^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}}) = -2220 \mathrm{ kJ/mol}.

Answer

ΔH=ΔHc(reactants)ΔHc(products)\Delta H = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})

=[3(393.5)+4(285.8)][(2220)]= [3(-393.5) + 4(-285.8)] - [(-2220)]

=[1180.5+(1143.2)](2220)= [-1180.5 + (-1143.2)] - (-2220)

=2323.7+2220=103.7kJ/mol= -2323.7 + 2220 = -103.7 \mathrm{ kJ/mol}

This is ΔHf(C3H8(g))\Delta H_f^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}})Matching the reference value of 103.8kJ/mol-103.8 \mathrm{ kJ/mol}.


The mean bond enthalpy is the average enthalpy change when 1 mole of a specified type of bond is Broken in the gaseous state, averaged over a range of compounds.

Bond breaking is always endothermic (ΔH>0\Delta H \gt 0). Bond forming is always exothermic (ΔH<0\Delta H \lt 0).

Using Bond Enthalpies to Estimate ΔH\Delta H

Section titled “Using Bond Enthalpies to Estimate ΔH\Delta HΔH”

ΔH(bondsbroken)(bondsformed)\Delta H \approx \sum (\mathrm{bonds broken}) - \sum (\mathrm{bonds formed})

BondEnthalpy (kJ/mol)BondEnthalpy (kJ/mol)
C—C347C—H413
C=C614O—H464
C\equivC839H—H436
C—O358O=O498
C=O805 (in CO2\mathrm{CO}_2)N\equivN945
C=O743 (in aldehydes/ketones)N—H391
C—Cl346F—F158
O—O146Cl—Cl243

Worked example 4: Estimate ΔH\Delta H for the combustion of methane using bond enthalpies.

CH4(g)+2O2(g)CO2(g)+2H2O(g)\mathrm{CH}_{4(g)} + 2\mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} + 2\mathrm{H}_2\mathrm{O}_{(g)}

Answer

Bonds broken:

  • 4 ×\times C—H = 4×413=1652kJ/mol4 \times 413 = 1652 \mathrm{ kJ/mol}
  • 2 ×\times O=O = 2×498=996kJ/mol2 \times 498 = 996 \mathrm{ kJ/mol}

Total bonds broken = 1652+996=2648kJ/mol1652 + 996 = 2648 \mathrm{ kJ/mol}

Bonds formed:

  • 2 ×\times C=O (in CO2\mathrm{CO}_2) = 2×805=1610kJ/mol2 \times 805 = 1610 \mathrm{ kJ/mol}
  • 4 ×\times O—H (in 2H2O2\mathrm{H}_2\mathrm{O}) = 4×464=1856kJ/mol4 \times 464 = 1856 \mathrm{ kJ/mol}

Total bonds formed = 1610+1856=3466kJ/mol1610 + 1856 = 3466 \mathrm{ kJ/mol}

ΔH=26483466=818kJ/mol\Delta H = 2648 - 3466 = -818 \mathrm{ kJ/mol}

Note: the accepted value is 890.3kJ/mol-890.3 \mathrm{ kJ/mol} (for H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}). The Discrepancy arises because bond enthalpies are averages and we used H2O(g)\mathrm{H}_2\mathrm{O}_{(g)} Rather than H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}.

Worked example 5: Using bond enthalpies, estimate the enthalpy change for:

N2(g)+3H2(g)2NH3(g)\mathrm{N}_{2(g)} + 3\mathrm{H}_{2(g)} \to 2\mathrm{NH}_{3(g)}

Answer

Bonds broken:

  • 1 ×\times N\equivN = 945kJ/mol945 \mathrm{ kJ/mol}
  • 3 ×\times H—H = 3×436=1308kJ/mol3 \times 436 = 1308 \mathrm{ kJ/mol}

Total bonds broken = 945+1308=2253kJ/mol945 + 1308 = 2253 \mathrm{ kJ/mol}

Bonds formed:

  • 6 ×\times N—H = 6×391=2346kJ/mol6 \times 391 = 2346 \mathrm{ kJ/mol}

ΔH=22532346=93kJ/mol\Delta H = 2253 - 2346 = -93 \mathrm{ kJ/mol}

For 2 mol NH3\mathrm{NH}_3: ΔH=93kJ\Delta H = -93 \mathrm{ kJ} So per mole of reaction: 93kJ/mol-93 \mathrm{ kJ/mol}.

Accepted ΔHf(NH3(g))=46.0kJ/mol\Delta H_f^\circ(\mathrm{NH}_{3(g)}) = -46.0 \mathrm{ kJ/mol} So ΔH=2×(46.0)=92.0kJ/mol\Delta H = 2 \times (-46.0) = -92.0 \mathrm{ kJ/mol}. The estimate is close.


Calorimetry measures the heat exchanged during a reaction by observing the temperature change of a Known mass of water (or solution).

q=mcΔTq = mc\Delta T

Where:

  • qq = heat energy (J)
  • mm = mass of water/solution (g)
  • cc = specific heat capacity (4.18 J g1^{-1} K1^{-1} for water)
  • ΔT\Delta T = temperature change (K or ^\circC)

ΔH=qn=mcΔTn\Delta H = -\frac{q}{n} = -\frac{mc\Delta T}{n}

The negative sign converts the perspective: if the solution temperature rises (ΔT>0\Delta T \gt 0), The reaction is exothermic (ΔH<0\Delta H \lt 0).

Used for reactions in solution (e.g., neutralisation, dissolution).

Assumptions:

  1. The density of the solution is 1.00 g/cm3^3 (so mass in g = volume in cm3^3).
  2. The specific heat capacity of the solution is the same as water (4.18 J g1^{-1} K1^{-1}).
  3. No heat is lost to the surroundings (or the calorimeter is well insulated).
  4. The calorimeter itself absorbs negligible heat.

Worked example 6: 50.0 cm3^3 of 1.00 mol/dm3^3 HCl is mixed with 50.0 cm3^3 of 1.00 Mol/dm3^3 NaOH in a polystyrene cup. The temperature rises from 22.0C22.0^\circ\mathrm{C} to 28.8C28.8^\circ\mathrm{C}. Calculate ΔH\Delta H for the neutralisation per mole of water formed.

Answer

Total volume = 50.0+50.0=100.0cm350.0 + 50.0 = 100.0 \mathrm{ cm}^3

Mass of solution = 100.0g100.0 \mathrm{ g} (density = 1.00 g/cm3^3)

ΔT=28.822.0=6.8C\Delta T = 28.8 - 22.0 = 6.8^\circ\mathrm{C}

q=mcΔT=100.0×4.18×6.8=2842J=2.842kJq = mc\Delta T = 100.0 \times 4.18 \times 6.8 = 2842 \mathrm{ J} = 2.842 \mathrm{ kJ}

Moles of H2O\mathrm{H}_2\mathrm{O} formed = moles of HCl\mathrm{HCl} = 1.00×50.0/1000=0.0500mol1.00 \times 50.0 / 1000 = 0.0500 \mathrm{ mol}

ΔH=2.8420.0500=56.8kJ/mol\Delta H = -\dfrac{2.842}{0.0500} = -56.8 \mathrm{ kJ/mol}

This is close to the standard value of 57.3kJ/mol-57.3 \mathrm{ kJ/mol}.

Used to measure enthalpies of combustion. A known mass of fuel is burned, and the temperature rise Of a known mass of water is measured.

Worked example 7: 1.50 g of ethanol is burned in a spirit burner. The heat produced raises the Temperature of 200 g of water from 20.0C20.0^\circ\mathrm{C} to 45.5C45.5^\circ\mathrm{C}. Calculate the Enthalpy of combustion of ethanol.

Answer

q=mcΔT=200×4.18×(45.520.0)=200×4.18×25.5=21318J=21.32kJq = mc\Delta T = 200 \times 4.18 \times (45.5 - 20.0) = 200 \times 4.18 \times 25.5 = 21318 \mathrm{ J} = 21.32 \mathrm{ kJ}

Moles of C2H5OH=1.50/46.1=0.0325mol\mathrm{C}_2\mathrm{H}_5\mathrm{OH} = 1.50 / 46.1 = 0.0325 \mathrm{ mol}

ΔHc=21.320.0325=656kJ/mol\Delta H_c = -\dfrac{21.32}{0.0325} = -656 \mathrm{ kJ/mol}

The accepted value is 1367kJ/mol-1367 \mathrm{ kJ/mol}. The experimental value is much less exothermic due To heat losses to the surroundings and incomplete combustion.

ErrorEffectMinimisation
Heat loss to surroundingsΔT\Delta T too small; ΔH\Delta H less negativeUse a polystyrene cup (good insulator)
Incomplete combustionLess heat releasedEnsure good air supply
Evaporation of fuel during weighingApparent mass too lowWeigh quickly; use a cap
Heat absorbed by calorimeterΔT\Delta T too smallAccount for calorimeter heat capacity

Born-Haber cycles calculate lattice energies of ionic compounds using Hess’s Law. The lattice energy Is the enthalpy change when 1 mole of an ionic solid is formed from its gaseous ions.

  1. Atomisation of sodium: Na(s)Na(g)\mathrm{Na}_{(s)} \to \mathrm{Na}_{(g)} (ΔHat=+108kJ/mol\Delta H_{\mathrm{at}}^\circ = +108 \mathrm{ kJ/mol})
  2. Ionisation of sodium: Na(g)Na(g)++e\mathrm{Na}_{(g)} \to \mathrm{Na}^+_{(g)} + e^- (IE1=+496kJ/mol\mathrm{IE}_1 = +496 \mathrm{ kJ/mol})
  3. Atomisation of chlorine: 12Cl2(g)Cl(g)\frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{Cl}_{(g)} (ΔHat=+122kJ/mol\Delta H_{\mathrm{at}}^\circ = +122 \mathrm{ kJ/mol})
  4. Electron affinity of chlorine: Cl(g)+eCl(g)\mathrm{Cl}_{(g)} + e^- \to \mathrm{Cl}^-_{(g)} (EA=349kJ/mol\mathrm{EA} = -349 \mathrm{ kJ/mol})
  5. Lattice energy: Na(g)++Cl(g)NaCl(s)\mathrm{Na}^+_{(g)} + \mathrm{Cl}^-_{(g)} \to \mathrm{NaCl}_{(s)} (ΔHlatt=?\Delta H_{\mathrm{latt}} = ?)
  6. Formation: Na(s)+12Cl2(g)NaCl(s)\mathrm{Na}_{(s)} + \frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{NaCl}_{(s)} (ΔHf=411kJ/mol\Delta H_f^\circ = -411 \mathrm{ kJ/mol})

By Hess’s Law:

ΔHf=ΔHat(Na)+IE1(Na)+ΔHat(Cl)+EA(Cl)+ΔHlatt\Delta H_f^\circ = \Delta H_{\mathrm{at}}(\mathrm{Na}) + \mathrm{IE}_1(\mathrm{Na}) + \Delta H_{\mathrm{at}}(\mathrm{Cl}) + \mathrm{EA}(\mathrm{Cl}) + \Delta H_{\mathrm{latt}}

411=108+496+122+(349)+ΔHlatt-411 = 108 + 496 + 122 + (-349) + \Delta H_{\mathrm{latt}}

411=377+ΔHlatt-411 = 377 + \Delta H_{\mathrm{latt}}

ΔHlatt=411377=788kJ/mol\Delta H_{\mathrm{latt}} = -411 - 377 = -788 \mathrm{ kJ/mol}

Worked example 8: Calculate the lattice energy of MgO\mathrm{MgO} given:

  • ΔHat(Mg)=+148kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{Mg}) = +148 \mathrm{ kJ/mol}
  • IE1(Mg)=+738kJ/mol\mathrm{IE}_1(\mathrm{Mg}) = +738 \mathrm{ kJ/mol}
  • IE2(Mg)=+1451kJ/mol\mathrm{IE}_2(\mathrm{Mg}) = +1451 \mathrm{ kJ/mol}
  • ΔHat(O)=+248kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{O}) = +248 \mathrm{ kJ/mol} (for 12O2(g)O(g)\frac{1}{2}\mathrm{O}_{2(g)} \to \mathrm{O}_{(g)})
  • EA1(O)=141kJ/mol\mathrm{EA}_1(\mathrm{O}) = -141 \mathrm{ kJ/mol}
  • EA2(O)=+798kJ/mol\mathrm{EA}_2(\mathrm{O}) = +798 \mathrm{ kJ/mol} (second electron affinity is endothermic)
  • ΔHf(MgO)=602kJ/mol\Delta H_f^\circ(\mathrm{MgO}) = -602 \mathrm{ kJ/mol}
Answer

ΔHf=ΔHat(Mg)+IE1+IE2+ΔHat(O)+EA1+EA2+ΔHlatt\Delta H_f^\circ = \Delta H_{\mathrm{at}}(\mathrm{Mg}) + \mathrm{IE}_1 + \mathrm{IE}_2 + \Delta H_{\mathrm{at}}(\mathrm{O}) + \mathrm{EA}_1 + \mathrm{EA}_2 + \Delta H_{\mathrm{latt}}

602=148+738+1451+248+(141)+798+ΔHlatt-602 = 148 + 738 + 1451 + 248 + (-141) + 798 + \Delta H_{\mathrm{latt}}

602=3242+ΔHlatt-602 = 3242 + \Delta H_{\mathrm{latt}}

ΔHlatt=6023242=3844kJ/mol\Delta H_{\mathrm{latt}} = -602 - 3242 = -3844 \mathrm{ kJ/mol}

The large magnitude reflects the high charges on Mg2+\mathrm{Mg}^{2+} and O2\mathrm{O}^{2-}.


Entropy is a measure of the disorder or randomness of a system.

ΔS=SproductsSreactants\Delta S = S_{\mathrm{products}} - S_{\mathrm{reactants}}

  1. Physical state: Gas >\gt Liquid >\gt Solid (increasing disorder).
  2. Temperature: Entropy increases with temperature.
  3. Number of particles: More particles (especially gas molecules) means higher entropy.
  4. Dissolution: Dissolving a solid in water generally increases entropy.
  • Reactions producing more gas molecules: ΔS>0\Delta S \gt 0.
  • Reactions consuming gas molecules: ΔS<0\Delta S \lt 0.
  • Solid to liquid or liquid to gas transitions: ΔS>0\Delta S \gt 0.

CaCO3(s)CaO(s)+CO2(g)ΔS>0(solidtosolid+gas)\mathrm{CaCO}_{3(s)} \to \mathrm{CaO}_{(s)} + \mathrm{CO}_{2(g)} \quad \Delta S \gt 0 \mathrm{ (solid to solid + gas)}

N2(g)+3H2(g)2NH3(g)ΔS<0(4molgasto2molgas)\mathrm{N}_{2(g)} + 3\mathrm{H}_{2(g)} \to 2\mathrm{NH}_{3(g)} \quad \Delta S \lt 0 \mathrm{ (4 mol gas to 2 mol gas)}

Typical values (J mol1^{-1} K1^{-1}):

SubstanceSS^\circ (J mol1^{-1} K1^{-1})
C(s)\mathrm{C}_{(s)}5.7
NaCl(s)\mathrm{NaCl}_{(s)}72.1
H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}69.9
H2O(g)\mathrm{H}_2\mathrm{O}_{(g)}188.7
CO2(g)\mathrm{CO}_{2(g)}213.6
N2(g)\mathrm{N}_{2(g)}191.5
NH3(g)\mathrm{NH}_{3(g)}192.3

ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S

Where:

  • ΔG\Delta G = Gibbs free energy change (kJ/mol)
  • ΔH\Delta H = enthalpy change (kJ/mol)
  • TT = temperature (K)
  • ΔS\Delta S = entropy change (kJ mol1^{-1} K1^{-1})