Skip to content

Trigonometry | DSE - Wyatt's Notes

Trigonometry is the study of relationships involving lengths and angles of triangles. It is a Central topic in the DSE Mathematics compulsory syllabus, connecting coordinate geometry) with algebraic techniques and serving as a foundation for Many applied problems in two and three dimensions.

Angles and Arcs

Degrees and Radians

Angles can be measured in degrees or radians. A full revolution is 360360^\circ or 2π2\pi radians, Giving the fundamental conversion:

\begin\{aligned\} 180^\circ = \pi \mathrm\{ rad\} \end\{aligned\}

To convert between the two units:

\begin\{aligned\} \theta_\{\mathrm\{rad\}\} &= \theta_\{\mathrm\{deg\}\} \times \frac\{\pi\}\{180\} \\[4pt] \theta_\{\mathrm\{deg\}\} &= \theta_\{\mathrm\{rad\}\} \times \frac\{180\}\{\pi\} \end\{aligned\}

The radian measure of a positive angle is the ratio of the arc length to the radius. Radians are a Dimensionless quantity and are the default unit in calculus and many advanced applications.

Common angle equivalences:

Degrees00^\circ3030^\circ4545^\circ6060^\circ9090^\circ120120^\circ180180^\circ270270^\circ360360^\circ
Radians00π6\frac{\pi}{6}π4\frac{\pi}{4}π3\frac{\pi}{3}π2\frac{\pi}{2}2π3\frac{2\pi}{3}π\pi3π2\frac{3\pi}{2}2π2\pi
Examples
  • Convert 150150^\circ to radians: 150×π180=5π6150 \times \frac{\pi}{180} = \frac{5\pi}{6} rad
  • Convert 7π4\frac{7\pi}{4} rad to degrees: 7π4×180π=315\frac{7\pi}{4} \times \frac{180}{\pi} = 315^\circ
  • Convert 1.21.2 rad to degrees: 1.2×180π68.751.2 \times \frac{180}{\pi} \approx 68.75^\circ

Arc Length

For an arc subtending an angle θ\theta (in radians) at the centre of a circle of radius rr:

\begin\{aligned\} l = r\theta \end\{aligned\}

This formula only applies when θ\theta is in radians. If the angle is given in degrees, convert to Radians first. This formula is also covered in the context of circles and sectors.

Area of a Sector

For a sector of a circle of radius rr with central angle θ\theta (in radians):

\begin\{aligned\} A = \frac\{1\}\{2\}r^2\theta \end\{aligned\}

The area of a segment (the region between a chord and its arc) is:

\begin\{aligned\} \mathrm\{Area of segment\} = \frac\{1\}\{2\}r^2(\theta - \sin\theta) \end\{aligned\}
Examples
  • A circle of radius 55 cm has a sector with angle 3π4\frac{3\pi}{4}. Arc length =5×3π4=15π411.78= 5 \times \frac{3\pi}{4} = \frac{15\pi}{4} \approx 11.78 cm. Area =12(25)(3π4)=75π829.45= \frac{1}{2}(25)\left(\frac{3\pi}{4}\right) = \frac{75\pi}{8} \approx 29.45 cm2^2.
  • Find the radius of a circle given that a sector of angle 2.52.5 rad has area 2020 cm2^2: 12r2(2.5)=20    r2=16    r=4\frac{1}{2}r^2(2.5) = 20 \implies r^2 = 16 \implies r = 4 cm.
  • A chord of length 66 cm subtends an angle of π3\frac{\pi}{3} at the centre. Find the area of the segment: r=3sin(π/6)=6r = \frac{3}{\sin(\pi/6)} = 6 cm. Area =12(36)(π3sinπ3)=18(π332)=6π933.26= \frac{1}{2}(36)\left(\frac{\pi}{3} - \sin\frac{\pi}{3}\right) = 18\left(\frac{\pi}{3} - \frac{\sqrt{3}}{2}\right) = 6\pi - 9\sqrt{3} \approx 3.26 cm2^2.

Trigonometric Ratios

Definitions in Right-Angled Triangles

For a right-angled triangle with an acute angle θ\thetaLabel the sides relative to θ\theta:

  • Opposite (O): the side opposite to angle θ\theta
  • Adjacent (A): the side adjacent to θ\theta (other than the hypotenuse)
  • Hypotenuse (H): the longest side, opposite the right angle

The three primary trigonometric ratios are:

\begin\{aligned\} \sin\theta &= \frac\{\mathrm\{Opposite\}\}\{\mathrm\{Hypotenuse\}\} = \frac\{O\}\{H\} \\[4pt] \cos\theta &= \frac\{\mathrm\{Adjacent\}\}\{\mathrm\{Hypotenuse\}\} = \frac\{A\}\{H\} \\[4pt] \tan\theta &= \frac\{\mathrm\{Opposite\}\}\{\mathrm\{Adjacent\}\} = \frac\{O\}\{A\} \end\{aligned\}

The mnemonic SOH CAH TOA helps recall these definitions.

Reciprocal Ratios

The three reciprocal trigonometric ratios are:

\begin\{aligned\} \csc\theta &= \frac\{1\}\{\sin\theta\} = \frac\{H\}\{O\} \\[4pt] \sec\theta &= \frac\{1\}\{\cos\theta\} = \frac\{H\}\{A\} \\[4pt] \cot\theta &= \frac\{1\}\{\tan\theta\} = \frac\{A\}\{O\} \end\{aligned\}
Examples
  • In a right-angled triangle, if the hypotenuse is 1313 and one leg is 55 Then \sin\theta = \frac{5}{13}$$\cos\theta = \frac{12}{13}$$\tan\theta = \frac{5}{12}.
  • Given tanθ=3\tan\theta = 3 and θ\theta is acute: construct a triangle with opposite =3= 3Adjacent =1= 1Hypotenuse =10= \sqrt{10}. Then sinθ=310\sin\theta = \frac{3}{\sqrt{10}} and cosθ=110\cos\theta = \frac{1}{\sqrt{10}}.
  • If secθ=53\sec\theta = \frac{5}{3} and θ\theta is in the first quadrant, then \cos\theta = \frac{3}{5}$$\sin\theta = \frac{4}{5} And tanθ=43\tan\theta = \frac{4}{3}.

Trigonometric Identities

Pythagorean Identity

For any angle θ\theta:

\begin\{aligned\} \sin^2\theta + \cos^2\theta = 1 \end\{aligned\}

This follows directly from the Pythagorean identity applied to a Right-angled triangle with hypotenuse 11. Two useful corollaries are obtained by dividing through By cos2θ\cos^2\theta or sin2θ\sin^2\theta:

\begin\{aligned\} 1 + \tan^2\theta &= \sec^2\theta \\[4pt] 1 + \cot^2\theta &= \csc^2\theta \end\{aligned\}

Quotient Identity

\begin\{aligned\} \tan\theta = \frac\{\sin\theta\}\{\cos\theta\}, \qquad \cot\theta = \frac\{\cos\theta\}\{\sin\theta\} \end\{aligned\}

These hold whenever the denominators are non-zero.

Additional identities useful for simplification and solving equations:

Double angle formulas (extension for stronger students):

\begin\{aligned\} \sin 2\theta &= 2\sin\theta\cos\theta \\[4pt] \cos 2\theta &= \cos^2\theta - \sin^2\theta = 2\cos^2\theta - 1 = 1 - 2\sin^2\theta \end\{aligned\}

Angle sum and difference (extension):

\begin\{aligned\} \sin(\alpha \pm \beta) &= \sin\alpha\cos\beta \pm \cos\alpha\sin\beta \\[4pt] \cos(\alpha \pm \beta) &= \cos\alpha\cos\beta \mp \sin\alpha\sin\beta \end\{aligned\}
Examples
  • Simplify sinθtanθ\frac{\sin\theta}{\tan\theta}: Since tanθ=sinθcosθ\tan\theta = \frac{\sin\theta}{\cos\theta}We have sinθsinθ/cosθ=cosθ\frac{\sin\theta}{\sin\theta / \cos\theta} = \cos\theta.
  • Given sinθ=35\sin\theta = \frac{3}{5} and θ\theta is in the second quadrant, find cosθ\cos\theta and tanθ\tan\theta: \cos\theta = -\sqrt{1 - \frac{9}{25}} = -\frac{4}{5}$$\tan\theta = \frac{3/5}{-4/5} = -\frac{3}{4}.
  • Prove 11+sinθ+11sinθ=2sec2θ\frac{1}{1 + \sin\theta} + \frac{1}{1 - \sin\theta} = 2\sec^2\theta: LHS =(1sinθ)+(1+sinθ)(1+sinθ)(1sinθ)=2cos2θ=2sec2θ= \frac{(1 - \sin\theta) + (1 + \sin\theta)}{(1 + \sin\theta)(1 - \sin\theta)} = \frac{2}{\cos^2\theta} = 2\sec^2\theta.

Exact Values

The exact trigonometric values for the standard angles must be memorised for the DSE examination:

θ\theta00^\circ (00)3030^\circ (π6)\left(\frac{\pi}{6}\right)4545^\circ (π4)\left(\frac{\pi}{4}\right)6060^\circ (π3)\left(\frac{\pi}{3}\right)9090^\circ (π2)\left(\frac{\pi}{2}\right)
sinθ\sin\theta0012\frac{1}{2}22\frac{\sqrt{2}}{2}32\frac{\sqrt{3}}{2}11
cosθ\cos\theta1132\frac{\sqrt{3}}{2}22\frac{\sqrt{2}}{2}12\frac{1}{2}00
tanθ\tan\theta0013\frac{1}{\sqrt{3}}113\sqrt{3}undefined

These values can be derived from the equilateral triangle (3030^\circ-6060^\circ-9090^\circ) and the Isosceles right-angled triangle (4545^\circ-4545^\circ-9090^\circ).

Examples
  • Evaluate 2sin30cos60=21212=122\sin 30^\circ \cos 60^\circ = 2 \cdot \frac{1}{2} \cdot \frac{1}{2} = \frac{1}{2}
  • Evaluate sin245+cos245=12+12=1\sin^2 45^\circ + \cos^2 45^\circ = \frac{1}{2} + \frac{1}{2} = 1 (confirms the Pythagorean identity)
  • Evaluate tan60sin30=31/2=23\frac{\tan 60^\circ}{\sin 30^\circ} = \frac{\sqrt{3}}{1/2} = 2\sqrt{3}
  • Simplify sinπ3cosπ6+cosπ3sinπ6=3232+1212=34+14=1\sin\frac{\pi}{3}\cos\frac{\pi}{6} + \cos\frac{\pi}{3}\sin\frac{\pi}{6} = \frac{\sqrt{3}}{2} \cdot \frac{\sqrt{3}}{2} + \frac{1}{2} \cdot \frac{1}{2} = \frac{3}{4} + \frac{1}{4} = 1

Graphs of Trigonometric Functions

{/prettier-ignore/}

Use the sliders to adjust amplitude, period, and phase shift, and observe how each parameter affects The graph.

y=sinxy = \sin x

PropertyValue
DomainAll real R\mathbb{R}
Range[1,1][-1, 1]
Period2π2\pi (or 360360^\circ)
Amplitude11
xx-interceptsn\pi$$n \in \mathbb{Z}
Maximum11 at x=π2+2nπx = \frac{\pi}{2} + 2n\pi
Minimum1-1 at x=3π2+2nπx = \frac{3\pi}{2} + 2n\pi

The graph is an odd function (sin(x)=sinx\sin(-x) = -\sin x), symmetric about the origin.

y=cosxy = \cos x

PropertyValue
DomainAll real R\mathbb{R}
Range[1,1][-1, 1]
Period2π2\pi (or 360360^\circ)
Amplitude11
xx-intercepts\frac{\pi}{2} + n\pi$$n \in \mathbb{Z}
Maximum11 at x=2nπx = 2n\pi
Minimum1-1 at x=π+2nπx = \pi + 2n\pi

The graph is an even function (cos(x)=cosx\cos(-x) = \cos x), symmetric about the yy-axis.

y=tanxy = \tan x

PropertyValue
Domainxπ2+nπx \neq \frac{\pi}{2} + n\pi
RangeAll real R\mathbb{R}
Periodπ\pi (or 180180^\circ)
AmplitudeNot defined (unbounded)
xx-interceptsn\pi$$n \in \mathbb{Z}
Asymptotesx=π2+nπx = \frac{\pi}{2} + n\pi

The graph is an odd function (tan(x)=tanx\tan(-x) = -\tan x). The tangent function has vertical asymptotes Where cosx=0\cos x = 0.

General Transformations

For transformed trigonometric functions of the form:

\begin\{aligned\} y &= a\sin(bx + c) + d \\ y &= a\cos(bx + c) + d \end\{aligned\}
ParameterEffect
a\|a\|
2πb\frac{2\pi}{\|b\|}
cb-\frac{c}{b}Phase shift (horizontal translation)
ddVertical shift (centre line at y=dy = d)
Examples
  • For y=3sin(2x)y = 3\sin(2x): amplitude =3= 3Period =2π2=π= \frac{2\pi}{2} = \piRange =[3,3]= [-3, 3].
  • For y=2cos(xπ3)+1y = -2\cos\left(x - \frac{\pi}{3}\right) + 1: amplitude =2= 2Period =2π= 2\piPhase shift =π3= \frac{\pi}{3} to the right, vertical shift =1= 1 up, range =[1,3]= [-1, 3].
  • For y=tan(x2)y = \tan\left(\frac{x}{2}\right): period =π1/2=2π= \frac{\pi}{1/2} = 2\piAsymptotes at x=π+2nπx = \pi + 2n\pi.
  • State the maximum and minimum of y=4sinx1y = 4\sin x - 1: maximum =4(1)1=3= 4(1) - 1 = 3Minimum =4(1)1=5= 4(-1) - 1 = -5.

Solving Trigonometric Equations

General Solutions

When solving \sin\theta = k$$\cos\theta = kOr tanθ=k\tan\theta = kThe solutions repeat Periodically. The general solutions (in degrees) are:

For sinθ=k\sin\theta = k (where 1k1-1 \leq k \leq 1), let α=arcsink\alpha = \arcsin k be the principal value In [90,90][-90^\circ, 90^\circ]:

\begin\{aligned\} \theta = 360^\circ n + \alpha \quad \mathrm\{or\} \quad \theta = 360^\circ n + (180^\circ - \alpha), \quad n \in \mathbb\{Z\} \end\{aligned\}

For cosθ=k\cos\theta = k (where 1k1-1 \leq k \leq 1), let α=arccosk\alpha = \arccos k be the principal value In [0,180][0^\circ, 180^\circ]:

\begin\{aligned\} \theta = 360^\circ n \pm \alpha, \quad n \in \mathbb\{Z\} \end\{aligned\}

For tanθ=k\tan\theta = k (for all real kk), let α=arctank\alpha = \arctan k be the principal value in (90,90)(-90^\circ, 90^\circ):

\begin\{aligned\} \theta = 180^\circ n + \alpha, \quad n \in \mathbb\{Z\} \end\{aligned\}

In radians, replace 360360^\circ with 2π2\pi and 180180^\circ with π\pi.

Solving Within a Given Interval

To find all solutions within a specified interval (e.g., 0θ<3600^\circ \leq \theta < 360^\circ or 0θ<2π0 \leq \theta < 2\pi):

  1. Find the principal value α\alpha using the inverse trigonometric function.
  2. Use the general solution formula to list all solutions in the required interval.
  3. Check each candidate to ensure it falls within the given range.

Using Identities to Simplify Equations

Many trigonometric equations require algebraic manipulation before they can be solved:

  • Factorisation: Extract common factors, e.g., 2sinθcosθsinθ=0    sinθ(2cosθ1)=02\sin\theta\cos\theta - \sin\theta = 0 \implies \sin\theta(2\cos\theta - 1) = 0.
  • Pythagorean substitution: Replace sin2θ\sin^2\theta with 1cos2θ1 - \cos^2\theta (or vice versa) to obtain an equation in a single function.
  • Quotient substitution: Replace tanθ\tan\theta with sinθcosθ\frac{\sin\theta}{\cos\theta} and clear denominators.
Examples
  • Solve sinθ=12\sin\theta = \frac{1}{2} for 0θ<3600^\circ \leq \theta < 360^\circ: α=30\alpha = 30^\circ. Solutions: θ=30\theta = 30^\circ or θ=18030=150\theta = 180^\circ - 30^\circ = 150^\circ.
  • Solve 2cos2θcosθ1=02\cos^2\theta - \cos\theta - 1 = 0 for 0θ<2π0 \leq \theta < 2\pi: Let u=cosθu = \cos\theta. Then 2u2u1=0    (2u+1)(u1)=02u^2 - u - 1 = 0 \implies (2u + 1)(u - 1) = 0. So cosθ=12\cos\theta = -\frac{1}{2} or cosθ=1\cos\theta = 1. Solutions: \theta = \frac{2\pi}{3}$$\theta = \frac{4\pi}{3}$$\theta = 0.
  • Solve sin2θ=cosθ\sin 2\theta = \cos\theta for 0θ<3600^\circ \leq \theta < 360^\circ: 2sinθcosθ=cosθ    cosθ(2sinθ1)=02\sin\theta\cos\theta = \cos\theta \implies \cos\theta(2\sin\theta - 1) = 0. Either cosθ=0    θ=90,270\cos\theta = 0 \implies \theta = 90^\circ, 270^\circOr sinθ=12    θ=30,150\sin\theta = \frac{1}{2} \implies \theta = 30^\circ, 150^\circ. Solutions: 30,90,150,27030^\circ, 90^\circ, 150^\circ, 270^\circ.
  • Solve tan2θ=3\tan^2\theta = 3 for 0θ<2π0 \leq \theta < 2\pi: tanθ=±3\tan\theta = \pm\sqrt{3}. tanθ=3    θ=π3,4π3\tan\theta = \sqrt{3} \implies \theta = \frac{\pi}{3}, \frac{4\pi}{3}. tanθ=3    θ=2π3,5π3\tan\theta = -\sqrt{3} \implies \theta = \frac{2\pi}{3}, \frac{5\pi}{3}.

Applications

Sine Rule

For any triangle ABCABC with sides a$$b$$c opposite the respective angles:

\begin\{aligned\} \frac\{a\}\{\sin A\} = \frac\{b\}\{\sin B\} = \frac\{c\}\{\sin C\} \end\{aligned\}

The sine rule is most useful when one side-side-angle (SSA) or angle-angle-side (AAS) configuration Is known. In the ambiguous SSA case, two distinct triangles may satisfy the given conditions (the “ambiguous case”).

Cosine Rule

For any triangle ABCABC with sides a$$b$$c opposite the respective angles:

\begin\{aligned\} a^2 &= b^2 + c^2 - 2bc\cos A \\[4pt] \cos A &= \frac\{b^2 + c^2 - a^2\}\{2bc\} \end\{aligned\}

The cosine rule generalises the Pythagorean theorem and is most useful for side-side-side (SSS) or Side-angle-side (SAS) configurations.

Area of a Triangle Using Trigonometry

\begin\{aligned\} \mathrm\{Area\} = \frac\{1\}\{2\}ab\sin C = \frac\{1\}\{2\}bc\sin A = \frac\{1\}\{2\}ca\sin B \end\{aligned\}

This is derived from the standard formula Area=12×base×height\mathrm{Area} = \frac{1}{2} \times \mathrm{base} \times \mathrm{height}Where the height is Expressed using a trigonometric ratio.

Bearings

A bearing is the angle measured clockwise from north. Key conventions:

  • Bearings are always given as three-digit numbers from 000000^\circ to 360360^\circ.
  • The bearing of BB from AA is generally different from the bearing of AA from BB (they differ by 180180^\circ unless the points are collinear with north).

Angles of Elevation and Depression

  • Angle of elevation: the angle above the horizontal from the observer to the object.
  • Angle of depression: the angle below the horizontal from the observer to the object.

When the observer and the object are at different heights, these two angles are equal if measured From corresponding horizontal lines (alternate angles).

3D Problems

Three-dimensional trigonometry problems often involve finding the angle between a line and a plane. The standard approach:

  1. Identify the relevant right-angled triangle in the 3D figure.
  2. Drop a perpendicular from a point to the plane to create a right angle.
  3. The angle between the line and the plane is the angle between the line and its projection onto the plane. If α\alpha is the angle between the line and the normal to the plane, then the angle ϕ\phi between the line and the plane satisfies ϕ=90α\phi = 90^\circ - \alpha.

This connects to the vector formulation described in the 3D geometry section.

Examples
  • In \triangle ABC$$a = 8$$b = 6$$C = 60^\circ. Find cc: c2=64+362(6)(8)cos60=10048=52c^2 = 64 + 36 - 2(6)(8)\cos 60^\circ = 100 - 48 = 52 So c=213c = 2\sqrt{13}.
  • In \triangle ABC$$a = 7$$A = 45^\circ$$B = 60^\circ. Find bb: bsin60=7sin45    b=73222=732=762\frac{b}{\sin 60^\circ} = \frac{7}{\sin 45^\circ} \implies b = \frac{7 \cdot \frac{\sqrt{3}}{2}}{\frac{\sqrt{2}}{2}} = \frac{7\sqrt{3}}{\sqrt{2}} = \frac{7\sqrt{6}}{2}.
  • A ship sails 1010 km on a bearing of 030030^\circ Then 88 km on a bearing of 120120^\circ. Find the distance from the starting point: The angle between the two legs is 12030=90120^\circ - 30^\circ = 90^\circ. Distance =102+82=24112.8= \sqrt{10^2 + 8^2} = 2\sqrt{41} \approx 12.8 km.
  • From the top of a 5050 m cliff, the angle of depression of a boat is 3030^\circ. Find the horizontal distance from the boat to the base of the cliff: tan30=50d    d=50tan30=50386.6\tan 30^\circ = \frac{50}{d} \implies d = \frac{50}{\tan 30^\circ} = 50\sqrt{3} \approx 86.6 m.
  • A vertical pole PQPQ stands on horizontal ground. Point AA is on the ground, 2020 m from the base QQ. The angle of elevation of PP from AA is 3535^\circ. Find the height of the pole: PQ=20tan3514.0PQ = 20\tan 35^\circ \approx 14.0 m.
  • In a cuboid ABCDEFGHABCDEFGH with AB = 4$$BC = 3$$CG = 5Find the angle between the diagonal AGAG and the base ABCDABCD: AG=16+9+25=50=52AG = \sqrt{16 + 9 + 25} = \sqrt{50} = 5\sqrt{2}. The projection of AGAG onto the base is AC=16+9=5AC = \sqrt{16 + 9} = 5. The angle between AGAG and the base =arccosACAG=arccos552=arccos12=45= \arccos\frac{AC}{AG} = \arccos\frac{5}{5\sqrt{2}} = \arccos\frac{1}{\sqrt{2}} = 45^\circ.

Wrap-up Questions
  1. Question: Convert 210210^\circ to radians and find the exact values of sin210\sin 210^\circ cos210\cos 210^\circ And tan210\tan 210^\circ.

Details

Answer
  • 210=210×π180=7π6210^\circ = 210 \times \frac{\pi}{180} = \frac{7\pi}{6} rad.
  • Reference angle: 210180=30210^\circ - 180^\circ = 30^\circ. Since 210210^\circ is in the third quadrant, both sine and cosine are negative.
  • sin210=sin30=12\sin 210^\circ = -\sin 30^\circ = -\frac{1}{2}
  • cos210=cos30=32\cos 210^\circ = -\cos 30^\circ = -\frac{\sqrt{3}}{2}
  • tan210=sin210cos210=1/23/2=13=33\tan 210^\circ = \frac{\sin 210^\circ}{\cos 210^\circ} = \frac{-1/2}{-\sqrt{3}/2} = \frac{1}{\sqrt{3}} = \frac{\sqrt{3}}{3}
  1. Question: A sector of a circle of radius 88 cm has an area of 32π32\pi cm2^2. Find the arc Length and the perimeter of the sector.
Answer
  • Area =12r2θ= \frac{1}{2}r^2\theta: 12(64)θ=32π    32θ=32π    θ=π\frac{1}{2}(64)\theta = 32\pi \implies 32\theta = 32\pi \implies \theta = \pi rad.
  • Arc length =rθ=8π= r\theta = 8\pi cm.
  • Perimeter of sector =2r+l=16+8π41.1= 2r + l = 16 + 8\pi \approx 41.1 cm.
  1. Question: Solve 3sin2θ2sinθ1=03\sin^2\theta - 2\sin\theta - 1 = 0 for 0θ<3600^\circ \leq \theta < 360^\circ.
Answer
  • Let u=sinθu = \sin\theta: 3u22u1=03u^2 - 2u - 1 = 0.
  • (3u+1)(u1)=0    u=13(3u + 1)(u - 1) = 0 \implies u = -\frac{1}{3} or u=1u = 1.
  • Case 1: sinθ=1    θ=90\sin\theta = 1 \implies \theta = 90^\circ.
  • Case 2: sinθ=13\sin\theta = -\frac{1}{3}. Principal value α=arcsin(13)19.47\alpha = \arcsin(-\frac{1}{3}) \approx -19.47^\circ.
  • θ=360+(19.47)=340.53\theta = 360^\circ + (-19.47^\circ) = 340.53^\circ or θ=180(19.47)=199.47\theta = 180^\circ - (-19.47^\circ) = 199.47^\circ.
  • Solutions: θ90,199.5,340.5\theta \approx 90^\circ, 199.5^\circ, 340.5^\circ.
  1. Question: In \triangle ABC$$a = 10$$b = 7$$c = 8. Find the largest angle of the Triangle.
Answer
  • The largest angle is opposite the longest side, so find A\angle A (opposite a=10a = 10).
  • By the cosine rule: cosA=b2+c2a22bc=49+641002(7)(8)=13112\cos A = \frac{b^2 + c^2 - a^2}{2bc} = \frac{49 + 64 - 100}{2(7)(8)} = \frac{13}{112}.
  • A=arccos(13112)83.3A = \arccos\left(\frac{13}{112}\right) \approx 83.3^\circ.
  1. Question: From a point AA on the ground, the angle of elevation of the top TT of a vertical Tower is 4040^\circ. From a point B$$30 m closer to the base of the tower, the angle of Elevation is 5555^\circ. Find the height of the tower.
Answer
  • Let the height be hh and let BB be xx m from the base. Then AA is (x+30)(x + 30) m from the base.
  • tan55=hx    h=xtan55\tan 55^\circ = \frac{h}{x} \implies h = x\tan 55^\circ.
  • tan40=hx+30    h=(x+30)tan40\tan 40^\circ = \frac{h}{x + 30} \implies h = (x + 30)\tan 40^\circ.
  • Equating: xtan55=(x+30)tan40x\tan 55^\circ = (x + 30)\tan 40^\circ.
  • x(tan55tan40)=30tan40x(\tan 55^\circ - \tan 40^\circ) = 30\tan 40^\circ.
  • x=30tan40tan55tan40=30(0.8391)1.42810.8391=25.170.58942.74x = \frac{30\tan 40^\circ}{\tan 55^\circ - \tan 40^\circ} = \frac{30(0.8391)}{1.4281 - 0.8391} = \frac{25.17}{0.589} \approx 42.74 m.
  • h=42.74×tan5542.74×1.428161.1h = 42.74 \times \tan 55^\circ \approx 42.74 \times 1.4281 \approx 61.1 m.
  1. Question: A ship SS is observed from two lighthouses AA and BB which are 55 km apart. The Bearing of BB from AA is 090090^\circ (due east), the bearing of SS from AA is 050050^\circ And The bearing of SS from BB is 320320^\circ. Find the distance of SS from AA.
Answer
  • The bearing of BB from AA is 090090^\circ So BB lies due east of AA. Place AA at the origin with north pointing up; then BB is at (5,0)(5, 0).
  • The bearing of SS from AA is 050050^\circ So the ray ASAS makes 5050^\circ with north (measured clockwise), i.e., 4040^\circ with the positive xx-axis. The bearing of SS from BB is 320320^\circ So the ray BSBS makes 360320=40360^\circ - 320^\circ = 40^\circ west of north, i.e., 130130^\circ with the positive xx-axis.
  • The interior angle at SS: the ray SASA points at bearing 230230^\circ (back-bearing) and the ray SBSB points at bearing 140140^\circ (back-bearing). The angle ASB=230140=90\angle ASB = 230^\circ - 140^\circ = 90^\circ.
  • In ABS\triangle ABS: BAS=9050=40\angle BAS = 90^\circ - 50^\circ = 40^\circ (angle between the east direction and the ray ASAS).
  • ABS=1804090=50\angle ABS = 180^\circ - 40^\circ - 90^\circ = 50^\circ.
  • Using the sine rule: ASsin50=5sin90=5\frac{AS}{\sin 50^\circ} = \frac{5}{\sin 90^\circ} = 5.
  • AS=5sin503.83AS = 5\sin 50^\circ \approx 3.83 km.
  1. Question: Prove the identity sinθ1cosθ=1+cosθsinθ\frac{\sin\theta}{1 - \cos\theta} = \frac{1 + \cos\theta}{\sin\theta} for sinθ0\sin\theta \neq 0.
Answer

Starting from the LHS, multiply numerator and denominator by (1+cosθ)(1 + \cos\theta):

sinθ1cosθ1+cosθ1+cosθ=sinθ(1+cosθ)1cos2θ\frac{\sin\theta}{1 - \cos\theta} \cdot \frac{1 + \cos\theta}{1 + \cos\theta} = \frac{\sin\theta(1 + \cos\theta)}{1 - \cos^2\theta}.

Since 1cos2θ=sin2θ1 - \cos^2\theta = \sin^2\theta (Pythagorean identity):

=sinθ(1+cosθ)sin2θ=1+cosθsinθ= \frac{\sin\theta(1 + \cos\theta)}{\sin^2\theta} = \frac{1 + \cos\theta}{\sin\theta}.

This equals the RHS, completing the ./1-number-and-algebra/3_proof-and-logic.

  1. Question: A pyramid has a square base ABCDABCD of side 66 cm and vertex VV. The slant edges VA=VB=VC=VD=52VA = VB = VC = VD = 5\sqrt{2} cm. Find (a) the height of the pyramid, and (b) the angle between The slant edge VAVA and the base.
Answer

(a) The centre OO of the square base is the foot of the perpendicular from VV. The diagonal AC=62AC = 6\sqrt{2} So AO=32AO = 3\sqrt{2}. In VOA\triangle VOA: VO2=VA2AO2=(52)2(32)2=5018=32VO^2 = VA^2 - AO^2 = (5\sqrt{2})^2 - (3\sqrt{2})^2 = 50 - 18 = 32. Height VO=32=42VO = \sqrt{32} = 4\sqrt{2} cm.

(b) The angle between VAVA and the base is VAO\angle VAO. cosVAO=AOVA=3252=35\cos\angle VAO = \frac{AO}{VA} = \frac{3\sqrt{2}}{5\sqrt{2}} = \frac{3}{5}. VAO=arccos3553.1\angle VAO = \arccos\frac{3}{5} \approx 53.1^\circ.

  1. Question: Sketch the graph of y=2sin(xπ4)+1y = 2\sin\left(x - \frac{\pi}{4}\right) + 1 for 0x2π0 \leq x \leq 2\pi. State the maximum value, minimum value, and the coordinates of all xx-intercepts in this interval.
Answer
  • Amplitude =2= 2Period =2π= 2\piPhase shift =π4= \frac{\pi}{4} to the right, vertical shift =1= 1.
  • Maximum =2(1)+1=3= 2(1) + 1 = 3Minimum =2(1)+1=1= 2(-1) + 1 = -1.
  • For xx-intercepts: 2sin(xπ4)+1=0    sin(xπ4)=122\sin\left(x - \frac{\pi}{4}\right) + 1 = 0 \implies \sin\left(x - \frac{\pi}{4}\right) = -\frac{1}{2}.
  • Let u=xπ4u = x - \frac{\pi}{4}. Since x[0,2π]x \in [0, 2\pi]We have u[π4,7π4]u \in \left[-\frac{\pi}{4}, \frac{7\pi}{4}\right].
  • General solutions for sinu=12\sin u = -\frac{1}{2}: u=7π6+2kπu = \frac{7\pi}{6} + 2k\pi or u=11π6+2kπu = \frac{11\pi}{6} + 2k\pi.
  • Also u=π6u = -\frac{\pi}{6} (which equals 11π62π\frac{11\pi}{6} - 2\pi) lies in [π4,7π4]\left[-\frac{\pi}{4}, \frac{7\pi}{4}\right].
  • u=7π6u = \frac{7\pi}{6} lies in the interval.
  • u=11π6u = \frac{11\pi}{6} lies in the interval.
  • x=u+π4x = u + \frac{\pi}{4} So x=π6+π4=π12x = -\frac{\pi}{6} + \frac{\pi}{4} = \frac{\pi}{12} x=7π6+π4=17π12x = \frac{7\pi}{6} + \frac{\pi}{4} = \frac{17\pi}{12} x=11π6+π4=25π12x = \frac{11\pi}{6} + \frac{\pi}{4} = \frac{25\pi}{12}. Since 25π12>2π\frac{25\pi}{12} \gt 2\piOnly two xx-intercepts lie in [0,2π][0, 2\pi].
  • xx-intercepts: (π12,0)\left(\frac{\pi}{12}, 0\right) and (17π12,0)\left(\frac{17\pi}{12}, 0\right).
  1. Question: Two observers AA and BB are on opposite sides of a vertical tower. AA and BB Are 100100 m apart on level ground. The angle of elevation of the top of the tower from AA is 3030^\circ and from BB is 4545^\circ. Find the height of the tower.
Answer
  • Let the tower be PQPQ of height hhWith base QQ between AA and BB.
  • Let AQ=xAQ = x m, then BQ=(100x)BQ = (100 - x) m.
  • tan30=hx    x=htan30=h3\tan 30^\circ = \frac{h}{x} \implies x = \frac{h}{\tan 30^\circ} = h\sqrt{3}.
  • tan45=h100x    100x=h\tan 45^\circ = \frac{h}{100 - x} \implies 100 - x = h.
  • Substituting: 100h3=h    100=h(1+3)100 - h\sqrt{3} = h \implies 100 = h(1 + \sqrt{3}).
  • h=1001+3=100(13)(1+3)(13)=100(13)2=50(31)36.6h = \frac{100}{1 + \sqrt{3}} = \frac{100(1 - \sqrt{3})}{(1 + \sqrt{3})(1 - \sqrt{3})} = \frac{100(1 - \sqrt{3})}{-2} = 50(\sqrt{3} - 1) \approx 36.6 M.
  1. Question: Solve cos2θ=sinθ\cos 2\theta = \sin\theta for 0θ<2π0 \leq \theta < 2\pi.
Answer
  • Using cos2θ=12sin2θ\cos 2\theta = 1 - 2\sin^2\theta: 12sin2θ=sinθ1 - 2\sin^2\theta = \sin\theta.
  • 2sin2θ+sinθ1=02\sin^2\theta + \sin\theta - 1 = 0.
  • Let u=sinθu = \sin\theta: 2u2+u1=0    (2u1)(u+1)=02u^2 + u - 1 = 0 \implies (2u - 1)(u + 1) = 0.
  • sinθ=12\sin\theta = \frac{1}{2} or sinθ=1\sin\theta = -1.
  • sinθ=12    θ=π6,5π6\sin\theta = \frac{1}{2} \implies \theta = \frac{\pi}{6}, \frac{5\pi}{6}.
  • sinθ=1    θ=3π2\sin\theta = -1 \implies \theta = \frac{3\pi}{2}.
  • Solutions: θ=π6,3π2,5π6\theta = \frac{\pi}{6}, \frac{3\pi}{2}, \frac{5\pi}{6}.
  1. Question: In \triangle ABC$$a = 5$$b = 7$$A = 40^\circ. Determine whether two Distinct triangles exist, and find all possible values of BB.
Answer
  • By the sine rule: sinB7=sin405\frac{\sin B}{7} = \frac{\sin 40^\circ}{5}.
  • sinB=7sin405=7(0.6428)5=0.8999\sin B = \frac{7\sin 40^\circ}{5} = \frac{7(0.6428)}{5} = 0.8999.
  • Since sinB<1\sin B < 1 and b>ab > a (i.e., 7>57 > 5), there is exactly one solution (no ambiguous case when the longer side is given opposite the known angle).
  • B=arcsin(0.8999)64.2B = \arcsin(0.8999) \approx 64.2^\circ.
  • C=1804064.2=75.8C = 180^\circ - 40^\circ - 64.2^\circ = 75.8^\circ.
  • c=5sin75.8sin405(0.9692)0.64287.54c = \frac{5\sin 75.8^\circ}{\sin 40^\circ} \approx \frac{5(0.9692)}{0.6428} \approx 7.54.
  • There is only one triangle, with B \approx 64.2^\circ$$C \approx 75.8^\circ$$c \approx 7.54.

For the A-Level treatment of this topic, see Trigonometry.


DSE Exam Technique

Showing Working

For trigonometry problems in DSE Paper 1:

  1. When solving equations, always find the principal value first, then use the general solution formula.
  2. State the domain restriction and verify each solution falls within the given interval.
  3. For ./1-number-and-algebra/3_proof-and-logic questions, work from one side to the other, showing each identity used.
  4. For 3D problems, draw a clear diagram and label all right-angled triangles used.

Significant Figures

Angle answers should be given to 3 significant figures unless exact values are possible (e.g., 30^\circ$$45^\circ$$60^\circ). Length answers to 3 significant figures.

Common DSE Question Types

  1. Solving trigonometric equations within a specified interval.
  2. Proving identities using Pythagorean, quotient, and double angle formulas.
  3. 2D problems using sine rule, cosine rule, and area formula.
  4. 3D problems involving angles between lines and planes.
  5. Bearing problems requiring careful diagram construction.

Additional Worked Examples

Worked Example 13: Proving an identity

Prove that 1cos2θ1+cos2θ=tan2θ\dfrac{1 - \cos 2\theta}{1 + \cos 2\theta} = \tan^2 \theta.

Solution

Starting from the LHS, using cos2θ=12sin2θ=2cos2θ1\cos 2\theta = 1 - 2\sin^2\theta = 2\cos^2\theta - 1:

1(12sin2θ)1+(2cos2θ1)=2sin2θ2cos2θ=sin2θcos2θ=tan2θ\frac{1 - (1 - 2\sin^2\theta)}{1 + (2\cos^2\theta - 1)} = \frac{2\sin^2\theta}{2\cos^2\theta} = \frac{\sin^2\theta}{\cos^2\theta} = \tan^2\theta

This equals the RHS. \qed\qed

Worked Example 14: 3D angle between line and plane

In the cuboid ABCDEFGHABCDEFGH where AB = 6$$BC = 8$$CG = 4Find the angle between the diagonal BHBH and the face ABCDABCD.

Solution

BH=62+82+42=36+64+16=116=229BH = \sqrt{6^2 + 8^2 + 4^2} = \sqrt{36 + 64 + 16} = \sqrt{116} = 2\sqrt{29}.

The projection of BHBH onto the base ABCDABCD is the diagonal BD=62+82=10BD = \sqrt{6^2 + 8^2} = 10.

The angle between BHBH and the base is ϕ\phi where cosϕ=BDBH=10229=529\cos\phi = \dfrac{BD}{BH} = \dfrac{10}{2\sqrt{29}} = \dfrac{5}{\sqrt{29}}.

ϕ=arccos ⁣(529)21.8\phi = \arccos\!\left(\frac{5}{\sqrt{29}}\right) \approx 21.8^\circ

Worked Example 15: Equation with double angle

Solve cos2θ+3cosθ+2=0\cos 2\theta + 3\cos\theta + 2 = 0 for 0θ<2π0 \leq \theta < 2\pi.

Solution

Using cos2θ=2cos2θ1\cos 2\theta = 2\cos^2\theta - 1:

2cos2θ1+3cosθ+2=02\cos^2\theta - 1 + 3\cos\theta + 2 = 0

2cos2θ+3cosθ+1=02\cos^2\theta + 3\cos\theta + 1 = 0

Let u=cosθu = \cos\theta: 2u2+3u+1=0    (2u+1)(u+1)=02u^2 + 3u + 1 = 0 \implies (2u + 1)(u + 1) = 0.

u=12u = -\dfrac{1}{2} or u=1u = -1.

cosθ=12    θ=2π3,4π3\cos\theta = -\dfrac{1}{2} \implies \theta = \dfrac{2\pi}{3}, \dfrac{4\pi}{3}.

cosθ=1    θ=π\cos\theta = -1 \implies \theta = \pi.

Solutions: θ=2π3,  π,  4π3\theta = \dfrac{2\pi}{3},\; \pi,\; \dfrac{4\pi}{3}.

Worked Example 16: Ambiguous case of sine rule

In \triangle ABC$$a = 8$$b = 10$$A = 40^\circ. Find all possible values of BB.

Solution

By the sine rule: sinB10=sin408\dfrac{\sin B}{10} = \dfrac{\sin 40^\circ}{8}.

sinB=10sin408=10(0.6428)8=0.8035\sin B = \frac{10\sin 40^\circ}{8} = \frac{10(0.6428)}{8} = 0.8035

Since sinB<1\sin B < 1 and b>ab > a (i.e., 10>810 > 8), there is exactly one solution:

B=arcsin(0.8035)53.5B = \arcsin(0.8035) \approx 53.5^\circ

(Note: the ambiguous case does not arise here because b>ab > a means B>A\angle B > \angle A So BB must be acute.)

C=1804053.5=86.5C = 180^\circ - 40^\circ - 53.5^\circ = 86.5^\circ.

c=8sin86.5sin408(0.9981)0.642812.4c = \dfrac{8\sin 86.5^\circ}{\sin 40^\circ} \approx \dfrac{8(0.9981)}{0.6428} \approx 12.4.

Worked Example 17: Area of triangle with sine rule

In ABC\triangle ABC, a=7a = 7, b=5b = 5, C=60C = 60^\circ. Find the area and the length of cc.

Solution

Area=12absinC=12(7)(5)sin60=353415.16\mathrm{Area} = \frac{1}{2}ab\sin C = \frac{1}{2}(7)(5)\sin 60^\circ = \frac{35\sqrt{3}}{4} \approx 15.16

By the cosine rule:

c2=72+522(7)(5)cos60=49+2535=39c^2 = 7^2 + 5^2 - 2(7)(5)\cos 60^\circ = 49 + 25 - 35 = 39

c=396.24c = \sqrt{39} \approx 6.24

Worked Example 18: Equation combining sin and cos

Solve 3sinθ+4cosθ=53\sin\theta + 4\cos\theta = 5 for 0θ<3600^\circ \leq \theta < 360^\circ.

Solution

Express 3sinθ+4cosθ3\sin\theta + 4\cos\theta in the form Rsin(θ+α)R\sin(\theta + \alpha).

R=32+42=5,α=arctan ⁣(43)53.13R = \sqrt{3^2 + 4^2} = 5, \quad \alpha = \arctan\!\left(\frac{4}{3}\right) \approx 53.13^\circ

5sin(θ+53.13)=5    sin(θ+53.13)=15\sin(\theta + 53.13^\circ) = 5 \implies \sin(\theta + 53.13^\circ) = 1

θ+53.13=90+360n\theta + 53.13^\circ = 90^\circ + 360^\circ n

θ=36.87+360n\theta = 36.87^\circ + 360^\circ n

In $ contains the hardest questions within the DSE specification for this topic, each with a full worked solution.

Unit tests probe edge cases and common misconceptions. Integration tests combine Trigonometry with other DSE mathematics topics to test synthesis under exam conditions.

See for instructions on self-marking and building a personal test matrix.

Common Pitfalls

  • Mixing up radians and degrees. Always check which unit is required; DSE uses radians in Paper 2.

  • Wrong sign in CAST diagram. Each quadrant has specific signs: All, Sine, Tangent, Cosine.

  • Incorrect trigonometric identities. sin2θ2sinθ\sin 2\theta \neq 2\sin\theta; the correct identity is sin2θ=2sinθcosθ\sin 2\theta = 2\sin\theta\cos\theta.

  • Exact values: sin30°=12\sin 30° = \frac{1}{2}, cos30°=32\cos 30° = \frac{\sqrt{3}}{2}, tan30°=13\tan 30° = \frac{1}{\sqrt{3}}; sin45°=cos45°=22\sin 45° = \cos 45° = \frac{\sqrt{2}}{2}; sin60°=32\sin 60° = \frac{\sqrt{3}}{2}, cos60°=12\cos 60° = \frac{1}{2}.

  • Double angle: sin2θ=2sinθcosθ\sin 2\theta = 2\sin\theta\cos\theta; cos2θ=cos2θsin2θ=2cos2θ1=12sin2θ\cos 2\theta = \cos^2\theta - \sin^2\theta = 2\cos^2\theta - 1 = 1 - 2\sin^2\theta.

  • CAST diagram determines the sign of trig functions in each quadrant.

  • π\pi radians =180°= 180°; arc length s=rθs = r\theta; sector area A=12r2θA = \frac{1}{2}r^2\theta (with θ\theta in radians).

  • Confusing sin(2x)\sin(2x) with 2sin(x)2\sin(x) — double-angle formulas are not the same as scalar multiplication.

Worked Examples

Example 1: Solving a trigonometric equation

Problem. Solve 2cos2θcosθ1=02\cos^2 \theta - \cos\theta - 1 = 0 for 0°θ<360°0° \leq \theta < 360°.

Solution. Let u=cosθu = \cos\theta: 2u2u1=0    (2u+1)(u1)=02u^2 - u - 1 = 0 \implies (2u + 1)(u - 1) = 0.

u=12u = -\frac{1}{2} or u=1u = 1.

cosθ=12    θ=120°\cos\theta = -\frac{1}{2} \implies \theta = 120° or 240°240° (2nd and 3rd quadrants).

cosθ=1    θ=0°\cos\theta = 1 \implies \theta = 0°.

Solutions: θ=0°,  120°,  240°\theta = 0°,\; 120°,\; 240°.

\blacksquare

Example 2: Using double angle formula

Problem. Given sinθ=35\sin\theta = \frac{3}{5} and θ\theta is acute, find sin2θ\sin 2\theta and cos2θ\cos 2\theta.

Solution. cosθ=1925=45\cos\theta = \sqrt{1 - \frac{9}{25}} = \frac{4}{5}.

sin2θ=2sinθcosθ=23545=2425\sin 2\theta = 2\sin\theta\cos\theta = 2 \cdot \frac{3}{5} \cdot \frac{4}{5} = \frac{24}{25}

cos2θ=cos2θsin2θ=1625925=725\cos 2\theta = \cos^2\theta - \sin^2\theta = \frac{16}{25} - \frac{9}{25} = \frac{7}{25}

\blacksquare

Cross-References

TopicSiteLink
[Trigonometry]A-LevelView
[Trigonometry]IBView
[Trigonometry]DSEView

======= 3. Incorrectly applying integration by parts by choosing uu and dvdx\frac{dv}{dx} the wrong way around.

  1. Dropping negative signs during algebraic manipulation. Substitute back to verify your answer.

    Stashed changes:docs/docs_dse/Maths/compulsory/trigonometry.md

flowchart TD
    A[10_Trigonometryx] --> B[Key Concepts]
    A --> C[Core Principles]
    A --> D[Practical Applications]
    B --> E[Fundamental definitions]
    C --> F[Design patterns]
    D --> G[Real-world usage]

Summary

The key principles covered in this topic are linked in the sub-pages above. Focus on understanding the definitions, applying the formulas or frameworks, and evaluating strengths and limitations of each approach.

Intuition

Mathematics provides the language for describing patterns, relationships, and change. Functions transform inputs to outputs like machines, calculus measures how things change and accumulate, and probability quantifies uncertainty. The power of mathematics lies in its ability to model real-world situations abstractly, allowing us to solve problems and make predictions across science, engineering, and everyday life.