Skip to main content

Chemistry - Energetics / Thermochemistry

Enthalpy Changes

Definitions

Enthalpy (HH): The heat content of a system at constant pressure. It is a state function.

Enthalpy change (ΔH\Delta H): The heat exchanged with the surroundings during a process at constant pressure.

ΔH=HproductsHreactants\Delta H = H_{\mathrm{products}} - H_{\mathrm{reactants}}

Exothermic and Endothermic Reactions

Exothermic: ΔH<0\Delta H \lt 0. Heat is released to the surroundings. The products have less enthalpy than the reactants.

Examples: combustion, neutralisation, respiration.

Endothermic: ΔH>0\Delta H \gt 0. Heat is absorbed from the surroundings. The products have more enthalpy than the reactants.

Examples: thermal decomposition, photosynthesis, dissolving NH4NO3\mathrm{NH}_4\mathrm{NO}_3 in water.

Standard Conditions

Standard enthalpy changes are measured under standard conditions:

  • Pressure: 1atm1 \mathrm{ atm} (101.3kPa101.3 \mathrm{ kPa})
  • Concentration: 1mol/dm31 \mathrm{ mol/dm}^3 for solutions
  • Temperature: usually 25C25^\circ\mathrm{C} (298K298 \mathrm{ K})
  • All substances in their standard states

The standard state is the pure substance at 1 atm and the specified temperature.


Standard Enthalpy Changes

Standard Enthalpy of Formation (ΔHf\Delta H_f^\circ)

The enthalpy change when 1 mole of a compound is formed from its elements in their standard states under standard conditions.

C(s)+O2(g)CO2(g)ΔHf=393.5kJ/mol\mathrm{C}_{(s)} + \mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} \quad \Delta H_f^\circ = -393.5 \mathrm{ kJ/mol}

By definition, ΔHf\Delta H_f^\circ of any element in its standard state = 0.

ΔHf(C(s,graphite))=0;ΔHf(H2(g))=0\Delta H_f^\circ(\mathrm{C}_{(s,\mathrm{ graphite})}) = 0 \quad ; \quad \Delta H_f^\circ(\mathrm{H}_{2(g)}) = 0

warning

warning involves formation FROM elements, not the other way around.

Standard Enthalpy of Combustion (ΔHc\Delta H_c^\circ)

The enthalpy change when 1 mole of a substance is completely burned in excess oxygen under standard conditions.

CH4(g)+2O2(g)CO2(g)+2H2O(l)ΔHc=890.3kJ/mol\mathrm{CH}_{4(g)} + 2\mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} + 2\mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_c^\circ = -890.3 \mathrm{ kJ/mol}

Combustion is always exothermic, so ΔHc<0\Delta H_c^\circ \lt 0.

Standard Enthalpy of Neutralisation (ΔHneut\Delta H_{\mathrm{neut}}^\circ)

The enthalpy change when 1 mole of water is formed from the reaction between an acid and an alkali under standard conditions.

H(aq)++OH(aq)H2O(l)ΔHneut=57.3kJ/mol\mathrm{H}^+_{(aq)} + \mathrm{OH}^-_{(aq)} \to \mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_{\mathrm{neut}}^\circ = -57.3 \mathrm{ kJ/mol}

For strong acid-strong base reactions, ΔHneut\Delta H_{\mathrm{neut}}^\circ is approximately constant at 57.3kJ/mol-57.3 \mathrm{ kJ/mol} because the net ionic equation is always the same.

For weak acid-strong base reactions, ΔHneut\Delta H_{\mathrm{neut}}^\circ is less exothermic (less negative) because energy is absorbed to dissociate the weak acid.

Standard Enthalpy of Atomisation (ΔHat\Delta H_{\mathrm{at}}^\circ)

The enthalpy change to form 1 mole of gaseous atoms from the element in its standard state.

12Cl2(g)Cl(g)ΔHat=+122kJ/mol\frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{Cl}_{(g)} \quad \Delta H_{\mathrm{at}}^\circ = +122 \mathrm{ kJ/mol}

This is always endothermic (bonds must be broken).

Key Reference Values

SubstanceΔHf\Delta H_f^\circ (kJ/mol)ΔHc\Delta H_c^\circ (kJ/mol)
CO2(g)\mathrm{CO}_{2(g)}393.5-393.5--
H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}285.8-285.8--
H2O(g)\mathrm{H}_2\mathrm{O}_{(g)}241.8-241.8--
CH4(g)\mathrm{CH}_{4(g)}74.8-74.8890.3-890.3
C2H5OH(l)\mathrm{C}_2\mathrm{H}_{5}\mathrm{OH}_{(l)}277.7-277.71367-1367
C3H8(g)\mathrm{C}_3\mathrm{H}_{8(g)}103.8-103.82220-2220
NH3(g)\mathrm{NH}_{3(g)}46.0-46.0383-383
NaOH(aq)\mathrm{NaOH}_{(aq)}470.1-470.1--

Hess's Law

Statement

Hess's Law states that the enthalpy change for a reaction is the same regardless of the route taken from reactants to products, provided the initial and final conditions are the same.

This is a consequence of enthalpy being a state function.

Hess's Law Cycles

Using Enthalpies of Formation:

ΔHreaction=ΔHf(products)ΔHf(reactants)\Delta H_{\mathrm{reaction}} = \sum \Delta H_f^\circ(\mathrm{products}) - \sum \Delta H_f^\circ(\mathrm{reactants})

Using Enthalpies of Combustion:

ΔHreaction=ΔHc(reactants)ΔHc(products)\Delta H_{\mathrm{reaction}} = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})

Note the reversal of signs compared to formation.

Worked example 1: Calculate ΔH\Delta H for the reaction:

C3H8(g)+5O2(g)3CO2(g)+4H2O(l)\mathrm{C}_{3\mathrm{H}_{8(g)}} + 5\mathrm{O}_{2(g)} \to 3\mathrm{CO}_{2(g)} + 4\mathrm{H}_2\mathrm{O}_{(l)}

Given: ΔHc(C3H8(g))=2220kJ/mol\Delta H_c^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}}) = -2220 \mathrm{ kJ/mol}, ΔHc(CO2(g))=0\Delta H_c^\circ(\mathrm{CO}_{2(g)}) = 0 (it is already fully oxidised), ΔHc(H2O(l))=0\Delta H_c^\circ(\mathrm{H}_2\mathrm{O}_{(l)}) = 0.

Answer

Since CO2\mathrm{CO}_2 and H2O\mathrm{H}_2\mathrm{O} are already combustion products, their ΔHc=0\Delta H_c^\circ = 0.

ΔH=ΔHc(C3H8)[3ΔHc(CO2)+4ΔHc(H2O)]\Delta H = \Delta H_c^\circ(\mathrm{C}_3\mathrm{H}_8) - [3\Delta H_c^\circ(\mathrm{CO}_2) + 4\Delta H_c^\circ(\mathrm{H}_2\mathrm{O})] =2220[3(0)+4(0)]=2220kJ/mol= -2220 - [3(0) + 4(0)] = -2220 \mathrm{ kJ/mol}

This makes sense: the enthalpy of combustion of propane equals the enthalpy change of its combustion reaction.

Worked example 2: Calculate ΔHf\Delta H_f^\circ of ethanol given:

C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔH=1367kJ/mol\mathrm{C}_2\mathrm{H}_{5}\mathrm{OH}_{(l)} + 3\mathrm{O}_{2(g)} \to 2\mathrm{CO}_{2(g)} + 3\mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H = -1367 \mathrm{ kJ/mol}

ΔHf(CO2(g))=393.5kJ/mol\Delta H_f^\circ(\mathrm{CO}_{2(g)}) = -393.5 \mathrm{ kJ/mol}, ΔHf(H2O(l))=285.8kJ/mol\Delta H_f^\circ(\mathrm{H}_2\mathrm{O}_{(l)}) = -285.8 \mathrm{ kJ/mol}

Answer

Using ΔH=ΔHf(products)ΔHf(reactants)\Delta H = \sum \Delta H_f^\circ(\mathrm{products}) - \sum \Delta H_f^\circ(\mathrm{reactants}):

1367=[2(393.5)+3(285.8)][ΔHf(C2H5OH)+3(0)]-1367 = [2(-393.5) + 3(-285.8)] - [\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) + 3(0)]

1367=[787.0+(857.4)]ΔHf(C2H5OH)-1367 = [-787.0 + (-857.4)] - \Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH})

1367=1644.4ΔHf(C2H5OH)-1367 = -1644.4 - \Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH})

ΔHf(C2H5OH)=1644.4+1367=277.4kJ/mol\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) = -1644.4 + 1367 = -277.4 \mathrm{ kJ/mol}

This agrees with the accepted value of 277.7kJ/mol-277.7 \mathrm{ kJ/mol}.

Worked example 3: Using enthalpies of combustion, calculate ΔH\Delta H for:

3C(s)+4H2(g)C3H8(g)3\mathrm{C}_{(s)} + 4\mathrm{H}_{2(g)} \to \mathrm{C}_3\mathrm{H}_{8(g)}

Given: ΔHc(C(s))=393.5kJ/mol\Delta H_c^\circ(\mathrm{C}_{(s)}) = -393.5 \mathrm{ kJ/mol} (same as ΔHc(CO2)\Delta H_c^\circ(\mathrm{CO}_2) since combustion of C gives CO2\mathrm{CO}_2), ΔHc(H2(g))=285.8kJ/mol\Delta H_c^\circ(\mathrm{H}_{2(g)}) = -285.8 \mathrm{ kJ/mol} (gives H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}), ΔHc(C3H8(g))=2220kJ/mol\Delta H_c^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}}) = -2220 \mathrm{ kJ/mol}.

Answer

ΔH=ΔHc(reactants)ΔHc(products)\Delta H = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})

=[3(393.5)+4(285.8)][(2220)]= [3(-393.5) + 4(-285.8)] - [(-2220)]

=[1180.5+(1143.2)](2220)= [-1180.5 + (-1143.2)] - (-2220)

=2323.7+2220=103.7kJ/mol= -2323.7 + 2220 = -103.7 \mathrm{ kJ/mol}

This is ΔHf(C3H8(g))\Delta H_f^\circ(\mathrm{C}_{3\mathrm{H}_{8(g)}}), matching the reference value of 103.8kJ/mol-103.8 \mathrm{ kJ/mol}.


Bond Enthalpies

Definition

The mean bond enthalpy is the average enthalpy change when 1 mole of a specified type of bond is broken in the gaseous state, averaged over a range of compounds.

Bond breaking is always endothermic (ΔH>0\Delta H \gt 0). Bond forming is always exothermic (ΔH<0\Delta H \lt 0).

Using Bond Enthalpies to Estimate ΔH\Delta H

ΔH(bondsbroken)(bondsformed)\Delta H \approx \sum (\mathrm{bonds broken}) - \sum (\mathrm{bonds formed})

Common Bond Enthalpies

BondEnthalpy (kJ/mol)BondEnthalpy (kJ/mol)
C--C347C--H413
C=C614O--H464
C\equivC839H--H436
C--O358O=O498
C=O805 (in CO2\mathrm{CO}_2)N\equivN945
C=O743 (in aldehydes/ketones)N--H391
C--Cl346F--F158
O--O146Cl--Cl243
warning

Bond enthalpies give only average values. For reactions involving the gas phase, they give good estimates. For reactions involving liquids or aqueous solutions, additional energy changes (vaporisation, dissolution) are not accounted for, so the estimate is less accurate.

Worked example 4: Estimate ΔH\Delta H for the combustion of methane using bond enthalpies.

CH4(g)+2O2(g)CO2(g)+2H2O(g)\mathrm{CH}_{4(g)} + 2\mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} + 2\mathrm{H}_2\mathrm{O}_{(g)}

Answer

Bonds broken:

  • 4 ×\times C--H = 4×413=1652kJ/mol4 \times 413 = 1652 \mathrm{ kJ/mol}
  • 2 ×\times O=O = 2×498=996kJ/mol2 \times 498 = 996 \mathrm{ kJ/mol}

Total bonds broken = 1652+996=2648kJ/mol1652 + 996 = 2648 \mathrm{ kJ/mol}

Bonds formed:

  • 2 ×\times C=O (in CO2\mathrm{CO}_2) = 2×805=1610kJ/mol2 \times 805 = 1610 \mathrm{ kJ/mol}
  • 4 ×\times O--H (in 2H2O2\mathrm{H}_2\mathrm{O}) = 4×464=1856kJ/mol4 \times 464 = 1856 \mathrm{ kJ/mol}

Total bonds formed = 1610+1856=3466kJ/mol1610 + 1856 = 3466 \mathrm{ kJ/mol}

ΔH=26483466=818kJ/mol\Delta H = 2648 - 3466 = -818 \mathrm{ kJ/mol}

Note: the accepted value is 890.3kJ/mol-890.3 \mathrm{ kJ/mol} (for H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}). The discrepancy arises because bond enthalpies are averages and we used H2O(g)\mathrm{H}_2\mathrm{O}_{(g)} rather than H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}.

Worked example 5: Using bond enthalpies, estimate the enthalpy change for:

N2(g)+3H2(g)2NH3(g)\mathrm{N}_{2(g)} + 3\mathrm{H}_{2(g)} \to 2\mathrm{NH}_{3(g)}

Answer

Bonds broken:

  • 1 ×\times N\equivN = 945kJ/mol945 \mathrm{ kJ/mol}
  • 3 ×\times H--H = 3×436=1308kJ/mol3 \times 436 = 1308 \mathrm{ kJ/mol}

Total bonds broken = 945+1308=2253kJ/mol945 + 1308 = 2253 \mathrm{ kJ/mol}

Bonds formed:

  • 6 ×\times N--H = 6×391=2346kJ/mol6 \times 391 = 2346 \mathrm{ kJ/mol}

ΔH=22532346=93kJ/mol\Delta H = 2253 - 2346 = -93 \mathrm{ kJ/mol}

For 2 mol NH3\mathrm{NH}_3: ΔH=93kJ\Delta H = -93 \mathrm{ kJ}, so per mole of reaction: 93kJ/mol-93 \mathrm{ kJ/mol}.

Accepted ΔHf(NH3(g))=46.0kJ/mol\Delta H_f^\circ(\mathrm{NH}_{3(g)}) = -46.0 \mathrm{ kJ/mol}, so ΔH=2×(46.0)=92.0kJ/mol\Delta H = 2 \times (-46.0) = -92.0 \mathrm{ kJ/mol}. The estimate is close.


Calorimetry

Principle

Calorimetry measures the heat exchanged during a reaction by observing the temperature change of a known mass of water (or solution).

q=mcΔTq = mc\Delta T

Where:

  • qq = heat energy (J)
  • mm = mass of water/solution (g)
  • cc = specific heat capacity (4.18 J g1^{-1} K1^{-1} for water)
  • ΔT\Delta T = temperature change (K or ^\circC)

ΔH=qn=mcΔTn\Delta H = -\frac{q}{n} = -\frac{mc\Delta T}{n}

The negative sign converts the perspective: if the solution temperature rises (ΔT>0\Delta T \gt 0), the reaction is exothermic (ΔH<0\Delta H \lt 0).

Solution Calorimetry

Used for reactions in solution (e.g., neutralisation, dissolution).

Assumptions:

  1. The density of the solution is 1.00 g/cm3^3 (so mass in g = volume in cm3^3).
  2. The specific heat capacity of the solution is the same as water (4.18 J g1^{-1} K1^{-1}).
  3. No heat is lost to the surroundings (or the calorimeter is well insulated).
  4. The calorimeter itself absorbs negligible heat.

Worked example 6: 50.0 cm3^3 of 1.00 mol/dm3^3 HCl is mixed with 50.0 cm3^3 of 1.00 mol/dm3^3 NaOH in a polystyrene cup. The temperature rises from 22.0C22.0^\circ\mathrm{C} to 28.8C28.8^\circ\mathrm{C}. Calculate ΔH\Delta H for the neutralisation per mole of water formed.

Answer

Total volume = 50.0+50.0=100.0cm350.0 + 50.0 = 100.0 \mathrm{ cm}^3

Mass of solution = 100.0g100.0 \mathrm{ g} (density = 1.00 g/cm3^3)

ΔT=28.822.0=6.8C\Delta T = 28.8 - 22.0 = 6.8^\circ\mathrm{C}

q=mcΔT=100.0×4.18×6.8=2842J=2.842kJq = mc\Delta T = 100.0 \times 4.18 \times 6.8 = 2842 \mathrm{ J} = 2.842 \mathrm{ kJ}

Moles of H2O\mathrm{H}_2\mathrm{O} formed = moles of HCl\mathrm{HCl} = 1.00×50.0/1000=0.0500mol1.00 \times 50.0 / 1000 = 0.0500 \mathrm{ mol}

ΔH=2.8420.0500=56.8kJ/mol\Delta H = -\dfrac{2.842}{0.0500} = -56.8 \mathrm{ kJ/mol}

This is close to the standard value of 57.3kJ/mol-57.3 \mathrm{ kJ/mol}.

Combustion Calorimetry

Used to measure enthalpies of combustion. A known mass of fuel is burned, and the temperature rise of a known mass of water is measured.

Worked example 7: 1.50 g of ethanol is burned in a spirit burner. The heat produced raises the temperature of 200 g of water from 20.0C20.0^\circ\mathrm{C} to 45.5C45.5^\circ\mathrm{C}. Calculate the enthalpy of combustion of ethanol.

Answer

q=mcΔT=200×4.18×(45.520.0)=200×4.18×25.5=21318J=21.32kJq = mc\Delta T = 200 \times 4.18 \times (45.5 - 20.0) = 200 \times 4.18 \times 25.5 = 21318 \mathrm{ J} = 21.32 \mathrm{ kJ}

Moles of C2H5OH=1.50/46.1=0.0325mol\mathrm{C}_2\mathrm{H}_5\mathrm{OH} = 1.50 / 46.1 = 0.0325 \mathrm{ mol}

ΔHc=21.320.0325=656kJ/mol\Delta H_c = -\dfrac{21.32}{0.0325} = -656 \mathrm{ kJ/mol}

The accepted value is 1367kJ/mol-1367 \mathrm{ kJ/mol}. The experimental value is much less exothermic due to heat losses to the surroundings and incomplete combustion.

Sources of Error in Calorimetry

ErrorEffectMinimisation
Heat loss to surroundingsΔT\Delta T too small; ΔH\Delta H less negativeUse a polystyrene cup (good insulator)
Incomplete combustionLess heat releasedEnsure good air supply
Evaporation of fuel during weighingApparent mass too lowWeigh quickly; use a cap
Heat absorbed by calorimeterΔT\Delta T too smallAccount for calorimeter heat capacity

Born-Haber Cycles

Overview

Born-Haber cycles calculate lattice energies of ionic compounds using Hess's Law. The lattice energy is the enthalpy change when 1 mole of an ionic solid is formed from its gaseous ions.

Steps in a Born-Haber Cycle (for NaCl)

  1. Atomisation of sodium: Na(s)Na(g)\mathrm{Na}_{(s)} \to \mathrm{Na}_{(g)} (ΔHat=+108kJ/mol\Delta H_{\mathrm{at}}^\circ = +108 \mathrm{ kJ/mol})
  2. Ionisation of sodium: Na(g)Na(g)++e\mathrm{Na}_{(g)} \to \mathrm{Na}^+_{(g)} + e^- (IE1=+496kJ/mol\mathrm{IE}_1 = +496 \mathrm{ kJ/mol})
  3. Atomisation of chlorine: 12Cl2(g)Cl(g)\frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{Cl}_{(g)} (ΔHat=+122kJ/mol\Delta H_{\mathrm{at}}^\circ = +122 \mathrm{ kJ/mol})
  4. Electron affinity of chlorine: Cl(g)+eCl(g)\mathrm{Cl}_{(g)} + e^- \to \mathrm{Cl}^-_{(g)} (EA=349kJ/mol\mathrm{EA} = -349 \mathrm{ kJ/mol})
  5. Lattice energy: Na(g)++Cl(g)NaCl(s)\mathrm{Na}^+_{(g)} + \mathrm{Cl}^-_{(g)} \to \mathrm{NaCl}_{(s)} (ΔHlatt=?\Delta H_{\mathrm{latt}} = ?)
  6. Formation: Na(s)+12Cl2(g)NaCl(s)\mathrm{Na}_{(s)} + \frac{1}{2}\mathrm{Cl}_{2(g)} \to \mathrm{NaCl}_{(s)} (ΔHf=411kJ/mol\Delta H_f^\circ = -411 \mathrm{ kJ/mol})

By Hess's Law:

ΔHf=ΔHat(Na)+IE1(Na)+ΔHat(Cl)+EA(Cl)+ΔHlatt\Delta H_f^\circ = \Delta H_{\mathrm{at}}(\mathrm{Na}) + \mathrm{IE}_1(\mathrm{Na}) + \Delta H_{\mathrm{at}}(\mathrm{Cl}) + \mathrm{EA}(\mathrm{Cl}) + \Delta H_{\mathrm{latt}}

411=108+496+122+(349)+ΔHlatt-411 = 108 + 496 + 122 + (-349) + \Delta H_{\mathrm{latt}}

411=377+ΔHlatt-411 = 377 + \Delta H_{\mathrm{latt}}

ΔHlatt=411377=788kJ/mol\Delta H_{\mathrm{latt}} = -411 - 377 = -788 \mathrm{ kJ/mol}

info

Lattice energy is always exothermic (negative) because energy is released when oppositely charged ions come together.

Worked example 8: Calculate the lattice energy of MgO\mathrm{MgO} given:

  • ΔHat(Mg)=+148kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{Mg}) = +148 \mathrm{ kJ/mol}
  • IE1(Mg)=+738kJ/mol\mathrm{IE}_1(\mathrm{Mg}) = +738 \mathrm{ kJ/mol}
  • IE2(Mg)=+1451kJ/mol\mathrm{IE}_2(\mathrm{Mg}) = +1451 \mathrm{ kJ/mol}
  • ΔHat(O)=+248kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{O}) = +248 \mathrm{ kJ/mol} (for 12O2(g)O(g)\frac{1}{2}\mathrm{O}_{2(g)} \to \mathrm{O}_{(g)})
  • EA1(O)=141kJ/mol\mathrm{EA}_1(\mathrm{O}) = -141 \mathrm{ kJ/mol}
  • EA2(O)=+798kJ/mol\mathrm{EA}_2(\mathrm{O}) = +798 \mathrm{ kJ/mol} (second electron affinity is endothermic)
  • ΔHf(MgO)=602kJ/mol\Delta H_f^\circ(\mathrm{MgO}) = -602 \mathrm{ kJ/mol}
Answer

ΔHf=ΔHat(Mg)+IE1+IE2+ΔHat(O)+EA1+EA2+ΔHlatt\Delta H_f^\circ = \Delta H_{\mathrm{at}}(\mathrm{Mg}) + \mathrm{IE}_1 + \mathrm{IE}_2 + \Delta H_{\mathrm{at}}(\mathrm{O}) + \mathrm{EA}_1 + \mathrm{EA}_2 + \Delta H_{\mathrm{latt}}

602=148+738+1451+248+(141)+798+ΔHlatt-602 = 148 + 738 + 1451 + 248 + (-141) + 798 + \Delta H_{\mathrm{latt}}

602=3242+ΔHlatt-602 = 3242 + \Delta H_{\mathrm{latt}}

ΔHlatt=6023242=3844kJ/mol\Delta H_{\mathrm{latt}} = -602 - 3242 = -3844 \mathrm{ kJ/mol}

The large magnitude reflects the high charges on Mg2+\mathrm{Mg}^{2+} and O2\mathrm{O}^{2-}.


Entropy (SS)

Definition

Entropy is a measure of the disorder or randomness of a system.

ΔS=SproductsSreactants\Delta S = S_{\mathrm{products}} - S_{\mathrm{reactants}}

Factors Affecting Entropy

  1. Physical state: Gas >\gt Liquid >\gt Solid (increasing disorder).
  2. Temperature: Entropy increases with temperature.
  3. Number of particles: More particles (especially gas molecules) means higher entropy.
  4. Dissolution: Dissolving a solid in water generally increases entropy.

Predicting Entropy Changes

  • Reactions producing more gas molecules: ΔS>0\Delta S \gt 0.
  • Reactions consuming gas molecules: ΔS<0\Delta S \lt 0.
  • Solid to liquid or liquid to gas transitions: ΔS>0\Delta S \gt 0.

CaCO3(s)CaO(s)+CO2(g)ΔS>0(solidtosolid+gas)\mathrm{CaCO}_{3(s)} \to \mathrm{CaO}_{(s)} + \mathrm{CO}_{2(g)} \quad \Delta S \gt 0 \mathrm{ (solid to solid + gas)}

N2(g)+3H2(g)2NH3(g)ΔS<0(4molgasto2molgas)\mathrm{N}_{2(g)} + 3\mathrm{H}_{2(g)} \to 2\mathrm{NH}_{3(g)} \quad \Delta S \lt 0 \mathrm{ (4 mol gas to 2 mol gas)}

Standard Entropy Values (SS^\circ)

Typical values (J mol1^{-1} K1^{-1}):

SubstanceSS^\circ (J mol1^{-1} K1^{-1})
C(s)\mathrm{C}_{(s)}5.7
NaCl(s)\mathrm{NaCl}_{(s)}72.1
H2O(l)\mathrm{H}_2\mathrm{O}_{(l)}69.9
H2O(g)\mathrm{H}_2\mathrm{O}_{(g)}188.7
CO2(g)\mathrm{CO}_{2(g)}213.6
N2(g)\mathrm{N}_{2(g)}191.5
NH3(g)\mathrm{NH}_{3(g)}192.3

Gibbs Free Energy (ΔG\Delta G)

Definition

ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S

Where:

  • ΔG\Delta G = Gibbs free energy change (kJ/mol)
  • ΔH\Delta H = enthalpy change (kJ/mol)
  • TT = temperature (K)
  • ΔS\Delta S = entropy change (kJ mol1^{-1} K1^{-1})
warning

Ensure units are consistent. If ΔH\Delta H is in kJ/mol and ΔS\Delta S is in J mol1^{-1} K1^{-1}, convert ΔS\Delta S to kJ mol1^{-1} K1^{-1} by dividing by 1000.

Feasibility of Reactions

ΔG\Delta GReaction
ΔG<0\Delta G \lt 0Feasible (spontaneous) under the given conditions
ΔG=0\Delta G = 0At equilibrium
ΔG>0\Delta G \gt 0Not feasible (non-spontaneous) under the given conditions

Effect of Temperature on Feasibility

The table below shows when ΔG<0\Delta G \lt 0 depending on the signs of ΔH\Delta H and ΔS\Delta S:

ΔH\Delta HΔS\Delta SΔG=ΔHTΔS\Delta G = \Delta H - T\Delta SFeasibility
-++Always negativeAlways feasible
++-Always positiveNever feasible
--Negative at low T, positive at high TFeasible at low T only
++++Positive at low T, negative at high TFeasible at high T only

Temperature of Equilibrium

When ΔG=0\Delta G = 0:

T=ΔHΔST = \frac{\Delta H}{\Delta S}

Worked example 9: For the decomposition of calcium carbonate:

CaCO3(s)CaO(s)+CO2(g)\mathrm{CaCO}_{3(s)} \to \mathrm{CaO}_{(s)} + \mathrm{CO}_{2(g)}

ΔH=+178kJ/mol\Delta H = +178 \mathrm{ kJ/mol}, ΔS=+0.161kJmol1K1\Delta S = +0.161 \mathrm{ kJ mol}^{-1} \mathrm{ K}^{-1}

Calculate the minimum temperature at which the reaction becomes feasible.

Answer

At ΔG=0\Delta G = 0: T=ΔHΔS=1780.161=1106K=833CT = \dfrac{\Delta H}{\Delta S} = \dfrac{178}{0.161} = 1106 \mathrm{ K} = 833^\circ\mathrm{C}

Above 833C833^\circ\mathrm{C}, the reaction becomes thermodynamically feasible.

Worked example 10: For the reaction N2(g)+3H2(g)2NH3(g)\mathrm{N}_{2(g)} + 3\mathrm{H}_{2(g)} \to 2\mathrm{NH}_{3(g)}:

ΔH=92.0kJ/mol\Delta H = -92.0 \mathrm{ kJ/mol}, ΔS=0.199kJmol1K1\Delta S = -0.199 \mathrm{ kJ mol}^{-1} \mathrm{ K}^{-1}

Is the reaction feasible at 298 K? At what temperature does it become non-feasible?

Answer

At 298 K:

ΔG=92.0298×(0.199)=92.0+59.3=32.7kJ/mol\Delta G = -92.0 - 298 \times (-0.199) = -92.0 + 59.3 = -32.7 \mathrm{ kJ/mol}

Since ΔG<0\Delta G \lt 0, the reaction is feasible at 298 K.

At ΔG=0\Delta G = 0: T=92.00.199=462K=189CT = \dfrac{-92.0}{-0.199} = 462 \mathrm{ K} = 189^\circ\mathrm{C}

Above 462 K, ΔG>0\Delta G \gt 0 and the reaction becomes non-feasible. However, in practice the Haber process operates at high temperature (400--500^\circC) for kinetic reasons (faster rate), and uses a catalyst and continuous removal of NH3\mathrm{NH}_3 to shift equilibrium.


Common Pitfalls

  1. Sign errors in Hess's Law: When using ΔHc\Delta H_c^\circ, remember: ΔH=ΔHc(reactants)ΔHc(products)\Delta H = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products}). The signs are reversed compared to using ΔHf\Delta H_f^\circ.

  2. Forgetting ΔHf=0\Delta H_f^\circ = 0 for elements: Elements in their standard states have zero enthalpy of formation. Do not skip them or assign them non-zero values.

  3. Bond enthalpy limitations: Bond enthalpies are averages. They do not account for intermolecular forces, phase changes, or the specific molecular environment. Estimates using bond enthalpies differ from experimental values.

  4. Unit inconsistency in Gibbs free energy: ΔH\Delta H is typically in kJ/mol, but ΔS\Delta S is often given in J mol1^{-1} K1^{-1}. Always convert to the same units.

  5. Calorimetry assumptions: Assuming no heat loss and density = 1.00 g/cm3^3 introduces systematic errors. Experimental values of ΔHc\Delta H_c are always less exothermic than literature values.

  6. Second electron affinity is endothermic: Adding a second electron to a negative ion (O\mathrm{O}^-) requires energy because of electron-electron repulsion.

  7. ΔG\Delta G predicts feasibility, not rate: A reaction with ΔG<0\Delta G \lt 0 may still be extremely slow. Thermodynamic feasibility does not imply kinetic practicality.


Practice Problems

Problem 1

Using the following data, calculate ΔHf\Delta H_f^\circ of CH3OH(l)\mathrm{CH}_3\mathrm{OH}_{(l)}:

ΔHc(C(s))=393.5kJ/mol\Delta H_c^\circ(\mathrm{C}_{(s)}) = -393.5 \mathrm{ kJ/mol} ΔHc(H2(g))=285.8kJ/mol\Delta H_c^\circ(\mathrm{H}_{2(g)}) = -285.8 \mathrm{ kJ/mol} ΔHc(CH3OH(l))=726.0kJ/mol\Delta H_c^\circ(\mathrm{CH}_3\mathrm{OH}_{(l)}) = -726.0 \mathrm{ kJ/mol}

Answer

Formation: C(s)+2H2(g)+12O2(g)CH3OH(l)\mathrm{C}_{(s)} + 2\mathrm{H}_{2(g)} + \frac{1}{2}\mathrm{O}_{2(g)} \to \mathrm{CH}_3\mathrm{OH}_{(l)}

ΔHf=ΔHc(reactants)ΔHc(products)\Delta H_f^\circ = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})

=[(393.5)+2(285.8)+0](726.0)= [(-393.5) + 2(-285.8) + 0] - (-726.0)

=[393.5571.6]+726.0= [-393.5 - 571.6] + 726.0

=965.1+726.0=239.1kJ/mol= -965.1 + 726.0 = -239.1 \mathrm{ kJ/mol}

Problem 2

Using bond enthalpies, estimate ΔH\Delta H for the hydrogenation of ethene:

C2H4(g)+H2(g)C2H6(g)\mathrm{C}_2\mathrm{H}_{4(g)} + \mathrm{H}_{2(g)} \to \mathrm{C}_2\mathrm{H}_{6(g)}

Answer

Bonds broken:

  • 1 ×\times C=C = 614
  • 4 ×\times C--H = 4×413=16524 \times 413 = 1652
  • 1 ×\times H--H = 436

Total bonds broken = 614+1652+436=2702kJ/mol614 + 1652 + 436 = 2702 \mathrm{ kJ/mol}

Bonds formed:

  • 1 ×\times C--C = 347
  • 6 ×\times C--H = 6×413=24786 \times 413 = 2478

Total bonds formed = 347+2478=2825kJ/mol347 + 2478 = 2825 \mathrm{ kJ/mol}

ΔH=27022825=123kJ/mol\Delta H = 2702 - 2825 = -123 \mathrm{ kJ/mol}

Problem 3

50.0 cm3^3 of 0.500 mol/dm3^3 HNO3\mathrm{HNO}_3 is added to 50.0 cm3^3 of 0.500 mol/dm3^3 KOH\mathrm{KOH}. The temperature rises from 21.0C21.0^\circ\mathrm{C} to 24.2C24.2^\circ\mathrm{C}. Calculate the enthalpy of neutralisation per mole of water formed.

Answer

Mass of solution = 100.0g100.0 \mathrm{ g}

ΔT=24.221.0=3.2C\Delta T = 24.2 - 21.0 = 3.2^\circ\mathrm{C}

q=100.0×4.18×3.2=1338J=1.338kJq = 100.0 \times 4.18 \times 3.2 = 1338 \mathrm{ J} = 1.338 \mathrm{ kJ}

Moles of H2O=0.500×50.0/1000=0.0250mol\mathrm{H}_2\mathrm{O} = 0.500 \times 50.0 / 1000 = 0.0250 \mathrm{ mol}

ΔH=1.338/0.0250=53.5kJ/mol\Delta H = -1.338 / 0.0250 = -53.5 \mathrm{ kJ/mol}

This is slightly less exothermic than 57.3kJ/mol-57.3 \mathrm{ kJ/mol} due to heat losses.

Problem 4

For the reaction C(s)+CO2(g)2CO(g)\mathrm{C}_{(s)} + \mathrm{CO}_{2(g)} \to 2\mathrm{CO}_{(g)}:

ΔH=+173kJ/mol\Delta H = +173 \mathrm{ kJ/mol}, ΔS=+0.176kJmol1K1\Delta S = +0.176 \mathrm{ kJ mol}^{-1} \mathrm{ K}^{-1}

Calculate ΔG\Delta G at 298 K and at 1000 K. At what temperature does the reaction become feasible?

Answer

At 298 K: ΔG=173298×0.176=17352.4=+120.6kJ/mol\Delta G = 173 - 298 \times 0.176 = 173 - 52.4 = +120.6 \mathrm{ kJ/mol}

Not feasible at 298 K.

At 1000 K: ΔG=1731000×0.176=173176=3kJ/mol\Delta G = 173 - 1000 \times 0.176 = 173 - 176 = -3 \mathrm{ kJ/mol}

Feasible at 1000 K.

At ΔG=0\Delta G = 0: T=173/0.176=983K=710CT = 173 / 0.176 = 983 \mathrm{ K} = 710^\circ\mathrm{C}

The reaction becomes feasible above 983 K.

Problem 5

Calculate the lattice energy of Na2O\mathrm{Na}_2\mathrm{O} given:

  • ΔHf(Na2O)=414kJ/mol\Delta H_f^\circ(\mathrm{Na}_2\mathrm{O}) = -414 \mathrm{ kJ/mol}
  • ΔHat(Na)=+108kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{Na}) = +108 \mathrm{ kJ/mol}
  • IE1(Na)=+496kJ/mol\mathrm{IE}_1(\mathrm{Na}) = +496 \mathrm{ kJ/mol}
  • IE2(Na)=+4562kJ/mol\mathrm{IE}_2(\mathrm{Na}) = +4562 \mathrm{ kJ/mol}
  • ΔHat(O)=+248kJ/mol\Delta H_{\mathrm{at}}^\circ(\mathrm{O}) = +248 \mathrm{ kJ/mol}
  • EA1(O)=141kJ/mol\mathrm{EA}_1(\mathrm{O}) = -141 \mathrm{ kJ/mol}
  • EA2(O)=+798kJ/mol\mathrm{EA}_2(\mathrm{O}) = +798 \mathrm{ kJ/mol}
Answer

Born-Haber cycle (for 1 mol Na2O\mathrm{Na}_2\mathrm{O}, so 2 mol Na):

ΔHf=2[ΔHat(Na)+IE1+IE2]+[ΔHat(O)+EA1+EA2]+ΔHlatt\Delta H_f^\circ = 2[\Delta H_{\mathrm{at}}(\mathrm{Na}) + \mathrm{IE}_1 + \mathrm{IE}_2] + [\Delta H_{\mathrm{at}}(\mathrm{O}) + \mathrm{EA}_1 + \mathrm{EA}_2] + \Delta H_{\mathrm{latt}}

414=2[108+496+4562]+[248+(141)+798]+ΔHlatt-414 = 2[108 + 496 + 4562] + [248 + (-141) + 798] + \Delta H_{\mathrm{latt}}

414=2(5166)+905+ΔHlatt-414 = 2(5166) + 905 + \Delta H_{\mathrm{latt}}

414=10332+905+ΔHlatt-414 = 10332 + 905 + \Delta H_{\mathrm{latt}}

414=11237+ΔHlatt-414 = 11237 + \Delta H_{\mathrm{latt}}

ΔHlatt=41411237=11651kJ/mol\Delta H_{\mathrm{latt}} = -414 - 11237 = -11651 \mathrm{ kJ/mol}

Problem 6

Explain why the experimental value of ΔHc\Delta H_c for ethanol determined by simple calorimetry (656kJ/mol-656 \mathrm{ kJ/mol}) is significantly less exothermic than the literature value (1367kJ/mol-1367 \mathrm{ kJ/mol}). Suggest two improvements to the experimental setup.

Answer

The discrepancy is due to:

  1. Heat loss to surroundings: Much of the heat produced escapes to the air and the calorimeter rather than being absorbed by the water.

  2. Incomplete combustion: Ethanol may burn incompletely, producing CO and soot instead of only CO2\mathrm{CO}_2 and H2O\mathrm{H}_2\mathrm{O}, releasing less heat per mole.

  3. Evaporation of ethanol: Some ethanol evaporates before/during combustion, meaning not all the measured mass actually burns.

Improvements:

  1. Use a bomb calorimeter (sealed, insulated vessel) to minimise heat loss and ensure complete combustion.

  2. Reduce the distance between the flame and the calorimeter, or use a draught shield to reduce convective heat loss.


Indirect Determination of Enthalpy Changes

Using Hess's Law with Multiple Steps

Some enthalpy changes cannot be measured directly and must be determined indirectly using known values and Hess's Law.

Worked example 7: Calculate the enthalpy change for:

C(s)+2H2(g)+12O2(g)CH3OH(l)\mathrm{C}_{(s)} + 2\mathrm{H}_{2(g)} + \frac{1}{2}\mathrm{O}_{2(g)} \to \mathrm{CH}_3\mathrm{OH}_{(l)}

Using the following data:

C(s)+O2(g)CO2(g)ΔH1=393.5kJ/mol\mathrm{C}_{(s)} + \mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} \quad \Delta H_1 = -393.5 \mathrm{ kJ/mol}

CH3OH(l)+32O2(g)CO2(g)+2H2O(l)ΔH2=726.0kJ/mol\mathrm{CH}_3\mathrm{OH}_{(l)} + \frac{3}{2}\mathrm{O}_{2(g)} \to \mathrm{CO}_{2(g)} + 2\mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_2 = -726.0 \mathrm{ kJ/mol}

H2(g)+12O2(g)H2O(l)ΔH3=285.8kJ/mol\mathrm{H}_{2(g)} + \frac{1}{2}\mathrm{O}_{2(g)} \to \mathrm{H}_2\mathrm{O}_{(l)} \quad \Delta H_3 = -285.8 \mathrm{ kJ/mol}

Answer

Route: C+2H2+12O2ΔHCH3OH\mathrm{C} + 2\mathrm{H}_2 + \frac{1}{2}\mathrm{O}_2 \xrightarrow{\Delta H} \mathrm{CH}_3\mathrm{OH}

Hess's Law cycle:

C+2H2+12O2ΔH1+2ΔH3CO2+2H2OΔH2CH3OH\mathrm{C} + 2\mathrm{H}_2 + \frac{1}{2}\mathrm{O}_2 \xrightarrow{\Delta H_1 + 2\Delta H_3} \mathrm{CO}_2 + 2\mathrm{H}_2\mathrm{O} \xrightarrow{-\Delta H_2} \mathrm{CH}_3\mathrm{OH}

ΔH=(ΔH1+2ΔH3)+(ΔH2)\Delta H = (\Delta H_1 + 2\Delta H_3) + (-\Delta H_2)

ΔH=(393.5+2(285.8))(726.0)\Delta H = (-393.5 + 2(-285.8)) - (-726.0)

ΔH=(393.5571.6)+726.0\Delta H = (-393.5 - 571.6) + 726.0

ΔH=965.1+726.0=239.1kJ/mol\Delta H = -965.1 + 726.0 = -239.1 \mathrm{ kJ/mol}

Dissolution Enthalpies

The enthalpy of solution is the enthalpy change when 1 mole of solute dissolves in a large excess of solvent to form an infinitely dilute solution.

NaCl(s)Na(aq)++Cl(aq)ΔHsol=+3.9kJ/mol\mathrm{NaCl}_{(s)} \to \mathrm{Na}^+_{(aq)} + \mathrm{Cl}^-_{(aq)} \quad \Delta H_{\mathrm{sol}}^\circ = +3.9 \mathrm{ kJ/mol}

The enthalpy of solution can be related to the lattice energy and the hydration enthalpy:

ΔHsol=ΔHlatt+ΔHhyd\Delta H_{\mathrm{sol}} = \Delta H_{\mathrm{latt}} + \Delta H_{\mathrm{hyd}}

Where ΔHlatt\Delta H_{\mathrm{latt}} is the lattice energy (endothermic, breaking the lattice) and ΔHhyd\Delta H_{\mathrm{hyd}} is the hydration enthalpy (exothermic, ions interacting with water).

For NaCl: ΔHlatt=+788kJ/mol\Delta H_{\mathrm{latt}} = +788 \mathrm{ kJ/mol}, ΔHhyd=784kJ/mol\Delta H_{\mathrm{hyd}} = -784 \mathrm{ kJ/mol}.

ΔHsol=+788+(784)=+4kJ/mol\Delta H_{\mathrm{sol}} = +788 + (-784) = +4 \mathrm{ kJ/mol}

This is slightly endothermic, consistent with the accepted value of +3.9kJ/mol+3.9 \mathrm{ kJ/mol}.


Temperature Changes and Enthalpy

Heat Capacity

The heat capacity (CC) of a substance is the amount of heat required to raise its temperature by 1 K.

C=qΔTC = \frac{q}{\Delta T}

For water: C=4.18Jg1K1C = 4.18 \mathrm{ J g}^{-1} \mathrm{ K}^{-1} (specific heat capacity, per gram).

Calorimeter Heat Capacity

In more accurate calorimetry, the heat absorbed by the calorimeter itself must be accounted for:

qtotal=(mwater×cwater+Ccalorimeter)×ΔTq_{\mathrm{total}} = (m_{\mathrm{water}} \times c_{\mathrm{water}} + C_{\mathrm{calorimeter}}) \times \Delta T

Worked example 8: A calorimeter has a heat capacity of 50.0 J/K. When 100 cm3^3 of 1.00 mol/dm3^3 HCl is mixed with 100 cm3^3 of 1.00 mol/dm3^3 NaOH, the temperature rises from 20.020.0^\circC to 26.726.7^\circC. Calculate ΔHneut\Delta H_{\mathrm{neut}}.

Answer

ΔT=26.720.0=6.7\Delta T = 26.7 - 20.0 = 6.7^\circC

qwater=200×4.18×6.7=5601Jq_{\mathrm{water}} = 200 \times 4.18 \times 6.7 = 5601 \mathrm{ J}

qcalorimeter=50.0×6.7=335Jq_{\mathrm{calorimeter}} = 50.0 \times 6.7 = 335 \mathrm{ J}

qtotal=5601+335=5936J=5.936kJq_{\mathrm{total}} = 5601 + 335 = 5936 \mathrm{ J} = 5.936 \mathrm{ kJ}

Moles of water = 1.00×100/1000=0.100mol1.00 \times 100 / 1000 = 0.100 \mathrm{ mol}

ΔH=5.936/0.100=59.4kJ/mol\Delta H = -5.936 / 0.100 = -59.4 \mathrm{ kJ/mol}


Summary of Key Equations

EquationUse
ΔH=ΔHf(products)ΔHf(reactants)\Delta H = \sum \Delta H_f^\circ(\mathrm{products}) - \sum \Delta H_f^\circ(\mathrm{reactants})Hess's Law (formation)
ΔH=ΔHc(reactants)ΔHc(products)\Delta H = \sum \Delta H_c^\circ(\mathrm{reactants}) - \sum \Delta H_c^\circ(\mathrm{products})Hess's Law (combustion)
ΔH(bondsbroken)(bondsformed)\Delta H \approx \sum (\mathrm{bonds broken}) - \sum (\mathrm{bonds formed})Bond enthalpy estimate
q=mcΔTq = mc\Delta TCalorimetry
ΔH=q/n\Delta H = -q/nFrom calorimetry to molar enthalpy
ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta SGibbs free energy
T=ΔH/ΔST = \Delta H / \Delta S (when ΔG=0\Delta G = 0)Feasibility temperature
ΔHsol=ΔHlatt+ΔHhyd\Delta H_{\mathrm{sol}} = \Delta H_{\mathrm{latt}} + \Delta H_{\mathrm{hyd}}Solution enthalpy