Skip to main content

DSE Chemistry Diagnostic: Acids, Bases and Salts

Unit Test 1: Weak Acid pH Calculation

Question

Ethanoic acid (CH3COOHCH_{3}COOH) is a weak acid with Ka=1.8×105K_{a} = 1.8 \times 10^{-5} mol/dm3^{3} at 25^{\circ}C.

(a) Calculate the pH of a 0.10 mol/dm3^{3} solution of ethanoic acid. [4 marks]

(b) Calculate the pH of a 0.010 mol/dm3^{3} solution of ethanoic acid. [2 marks]

(c) A student claims that diluting a weak acid by a factor of 10 will increase the pH by exactly 1. Evaluate this claim by comparing your answers to (a) and (b). [2 marks]


Worked Solution

(a) CH3COOHCH3COO+H+CH_{3}COOH \rightleftharpoons CH_{3}COO^{-} + H^{+}

Ka=[CH3COO][H+][CH3COOH]K_{a} = \frac{[CH_{3}COO^{-}][H^{+}]}{[CH_{3}COOH]}

At equilibrium, let [H+]=x[H^{+}] = x:

1.8×105=xx0.10x1.8 \times 10^{-5} = \frac{x \cdot x}{0.10 - x}

Assuming x0.10x \ll 0.10 (i.e., dissociation is small):

1.8×105x20.101.8 \times 10^{-5} \approx \frac{x^{2}}{0.10}

x2=1.8×106x^{2} = 1.8 \times 10^{-6}

x=1.34×103 mol/dm3x = 1.34 \times 10^{-3} \text{ mol/dm}^{3}

Check: x/0.10=1.34%<5%x/0.10 = 1.34\% \lt 5\% -- assumption valid.

pH=log(1.34×103)=2.87pH = -\log(1.34 \times 10^{-3}) = 2.87

(b) 1.8×105=x20.0101.8 \times 10^{-5} = \frac{x^{2}}{0.010}

x2=1.8×107x^{2} = 1.8 \times 10^{-7}

x=4.24×104 mol/dm3x = 4.24 \times 10^{-4} \text{ mol/dm}^{3}

pH=log(4.24×104)=3.37pH = -\log(4.24 \times 10^{-4}) = 3.37

(c) The pH change: 3.372.87=0.503.37 - 2.87 = 0.50.

The claim is incorrect for weak acids. Diluting by a factor of 10 increases the pH by less than 1. This is because dilution shifts the equilibrium to the right (Le Chatelier's principle), causing a greater fraction of the acid to dissociate. The [H+][H^{+}] does not decrease by a full factor of 10.

(For a strong acid, the claim would be correct since [H+][H^{+}] directly decreases by a factor of 10, increasing pH by exactly 1.)


Unit Test 2: Buffer Solution

Question

A buffer solution is prepared by mixing 100 cm3^{3} of 0.20 mol/dm3^{3} ethanoic acid (CH3COOHCH_{3}COOH, Ka=1.8×105K_{a} = 1.8 \times 10^{-5}) with 100 cm3^{3} of 0.10 mol/dm3^{3} sodium ethanoate (CH3COONaCH_{3}COONa).

(a) Calculate the pH of this buffer solution. [4 marks]

(b) Calculate the new pH after adding 5.0 cm3^{3} of 0.10 mol/dm3^{3} HCl to 50.0 cm3^{3} of the buffer. [4 marks]

(c) Explain why this buffer resists changes in pH when a small amount of strong acid is added. [2 marks]


Worked Solution

(a) After mixing, total volume = 200 cm3^{3}.

[CH3COOH]=0.20×100200=0.10 mol/dm3[CH_{3}COOH] = \frac{0.20 \times 100}{200} = 0.10 \text{ mol/dm}^{3}

[CH3COO]=0.10×100200=0.050 mol/dm3[CH_{3}COO^{-}] = \frac{0.10 \times 100}{200} = 0.050 \text{ mol/dm}^{3}

Using the Henderson-Hasselbalch equation:

pH=pKa+log[CH3COO][CH3COOH]pH = pK_{a} + \log\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]}

pKa=log(1.8×105)=4.74pK_{a} = -\log(1.8 \times 10^{-5}) = 4.74

pH=4.74+log0.0500.10=4.74+log(0.5)=4.740.30=4.44pH = 4.74 + \log\frac{0.050}{0.10} = 4.74 + \log(0.5) = 4.74 - 0.30 = 4.44

(b) In 50.0 cm3^{3} of buffer:

n(CH3COOH)=0.10×0.050=0.00500 moln(CH_{3}COOH) = 0.10 \times 0.050 = 0.00500 \text{ mol}

n(CH3COO)=0.050×0.050=0.00250 moln(CH_{3}COO^{-}) = 0.050 \times 0.050 = 0.00250 \text{ mol}

Moles of HClHCl added: n(HCl)=0.10×0.0050=0.000500n(HCl) = 0.10 \times 0.0050 = 0.000500 mol

The H+H^{+} from HCl reacts with CH3COOCH_{3}COO^{-}:

CH_{3}COO^{-} + H^{+} \rightarrow CH_{3}COOH}

New moles:

n(CH3COO)=0.002500.000500=0.00200 moln(CH_{3}COO^{-}) = 0.00250 - 0.000500 = 0.00200 \text{ mol}

n(CH3COOH)=0.00500+0.000500=0.00550 moln(CH_{3}COOH) = 0.00500 + 0.000500 = 0.00550 \text{ mol}

New total volume = 50.0+5.0=55.050.0 + 5.0 = 55.0 cm3^{3}:

[CH3COOH]=0.005500.0550=0.100 mol/dm3[CH_{3}COOH] = \frac{0.00550}{0.0550} = 0.100 \text{ mol/dm}^{3}

[CH3COO]=0.002000.0550=0.0364 mol/dm3[CH_{3}COO^{-}] = \frac{0.00200}{0.0550} = 0.0364 \text{ mol/dm}^{3}

pH=4.74+log0.03640.100=4.74+log(0.364)=4.740.439=4.30pH = 4.74 + \log\frac{0.0364}{0.100} = 4.74 + \log(0.364) = 4.74 - 0.439 = 4.30

(c) The buffer contains a weak acid (CH3COOHCH_{3}COOH) and its conjugate base (CH3COOCH_{3}COO^{-}). When a strong acid (H+H^{+}) is added, the H+H^{+} ions react with CH3COOCH_{3}COO^{-} to form CH3COOHCH_{3}COOH, consuming most of the added H+H^{+} and preventing a significant drop in pH.


Unit Test 3: Salt Hydrolysis

Question

(a) Predict whether an aqueous solution of ammonium chloride (NH4ClNH_{4}Cl) is acidic, alkaline, or neutral. Explain your answer using the concept of hydrolysis. [3 marks]

(b) Predict whether an aqueous solution of sodium ethanoate (CH3COONaCH_{3}COONa) is acidic, alkaline, or neutral. Explain. [3 marks]

(c) Predict whether an aqueous solution of sodium chloride (NaClNaCl) is acidic, alkaline, or neutral. Explain. [1 mark]


Worked Solution

(a) NH4ClNH_{4}Cl solution is acidic (pH<7pH \lt 7).

NH4ClNH_{4}Cl dissociates completely in water: NH4ClNH4++ClNH_{4}Cl \rightarrow NH_{4}^{+} + Cl^{-}.

The ammonium ion (NH4+NH_{4}^{+}) is the conjugate acid of the weak base ammonia (NH3NH_{3}). It undergoes hydrolysis:

NH4++H2ONH3+H3O+NH_{4}^{+} + H_{2}O \rightleftharpoons NH_{3} + H_{3}O^{+}

This reaction releases H3O+H_{3}O^{+} ions, making the solution acidic. The chloride ion (ClCl^{-}) is the conjugate base of a strong acid (HClHCl) and does not hydrolyse.

(b) CH3COONaCH_{3}COONa solution is alkaline (pH>7pH \gt 7).

CH3COONaCH_{3}COONa dissociates completely: CH3COONaCH3COO+Na+CH_{3}COONa \rightarrow CH_{3}COO^{-} + Na^{+}.

The ethanoate ion (CH3COOCH_{3}COO^{-}) is the conjugate base of the weak acid ethanoic acid (CH3COOHCH_{3}COOH). It undergoes hydrolysis:

CH3COO+H2OCH3COOH+OHCH_{3}COO^{-} + H_{2}O \rightleftharpoons CH_{3}COOH + OH^{-}

This reaction produces OHOH^{-} ions, making the solution alkaline. The sodium ion (Na+Na^{+}) does not hydrolyse.

(c) NaClNaCl solution is neutral (pH=7pH = 7).

Both Na+Na^{+} (conjugate acid of the strong base NaOHNaOH) and ClCl^{-} (conjugate base of the strong acid HClHCl) do not undergo hydrolysis. Neither ion affects the pHpH of the solution.


Integration Test 1: Titration Curve + Indicator Choice

Question

25.0 cm3^{3} of 0.100 mol/dm3^{3} ammonia solution (NH3NH_{3}, Kb=1.8×105K_{b} = 1.8 \times 10^{-5}) is titrated with 0.100 mol/dm3^{3} hydrochloric acid.

(a) Calculate the pH of the ammonia solution before any acid is added. [3 marks]

(b) Calculate the pH at the equivalence point. [3 marks]

(c) State and explain the most suitable indicator for this titration. [2 marks]


Worked Solution

(a) NH3+H2ONH4++OHNH_{3} + H_{2}O \rightleftharpoons NH_{4}^{+} + OH^{-}

Kb=[NH4+][OH][NH3]=1.8×105K_{b} = \frac{[NH_{4}^{+}][OH^{-}]}{[NH_{3}]} = 1.8 \times 10^{-5}

Let [OH]=x[OH^{-}] = x:

1.8×105=x20.1001.8 \times 10^{-5} = \frac{x^{2}}{0.100}

x=1.8×106=1.34×103 mol/dm3x = \sqrt{1.8 \times 10^{-6}} = 1.34 \times 10^{-3} \text{ mol/dm}^{3}

pOH=log(1.34×103)=2.87pOH = -\log(1.34 \times 10^{-3}) = 2.87

pH=142.87=11.13pH = 14 - 2.87 = 11.13

(b) At the equivalence point, all NH3NH_{3} has been converted to NH4+NH_{4}^{+}.

Moles of NH3NH_{3} = 0.100×0.0250=0.002500.100 \times 0.0250 = 0.00250 mol

Volume of HCl needed = 25.025.0 cm3^{3} (equimolar), total volume = 50.050.0 cm3^{3}.

[NH4+]=0.002500.0500=0.0500 mol/dm3[NH_{4}^{+}] = \frac{0.00250}{0.0500} = 0.0500 \text{ mol/dm}^{3}

NH4+NH_{4}^{+} hydrolyses: NH4++H2ONH3+H3O+NH_{4}^{+} + H_{2}O \rightleftharpoons NH_{3} + H_{3}O^{+}

Ka=KwKb=1.0×10141.8×105=5.56×1010K_{a} = \frac{K_{w}}{K_{b}} = \frac{1.0 \times 10^{-14}}{1.8 \times 10^{-5}} = 5.56 \times 10^{-10}

5.56×1010=x20.05005.56 \times 10^{-10} = \frac{x^{2}}{0.0500}

x=2.78×1011=5.27×106x = \sqrt{2.78 \times 10^{-11}} = 5.27 \times 10^{-6}

pH=log(5.27×106)=5.28pH = -\log(5.27 \times 10^{-6}) = 5.28

(c) The equivalence point pH is 5.28, which is acidic. The most suitable indicator is one whose colour change range includes pH 5.28. Methyl orange (pH range 3.1--4.4) is too low. Bromocresol green (pH range 3.8--5.4) would be suitable. Methyl red (pH range 4.4--6.2) is also a good choice. Phenolphthalein (pH range 8.3--10.0) would NOT be suitable as the colour change occurs well above the equivalence point pH.


Integration Test 2: pH Mixing and Neutralisation

Question

(a) Calculate the pH when 10.0 cm3^{3} of 0.100 mol/dm3^{3} NaOH is added to 40.0 cm3^{3} of 0.100 mol/dm3^{3} HCl. [3 marks]

(b) Calculate the pH when 30.0 cm3^{3} of 0.100 mol/dm3^{3} NaOH is added to 40.0 cm3^{3} of 0.100 mol/dm3^{3} HCl. [3 marks]

(c) Explain why the pH changes much more dramatically between the two scenarios in (a) and (b) than between adding 10.0 cm3^{3} and 20.0 cm3^{3} of NaOH. [2 marks]


Worked Solution

(a) Moles of HClHCl: 0.100×0.0400=0.004000.100 \times 0.0400 = 0.00400 mol

Moles of NaOH: 0.100×0.0100=0.001000.100 \times 0.0100 = 0.00100 mol

HClHCl is in excess by: 0.004000.00100=0.003000.00400 - 0.00100 = 0.00300 mol

Total volume = 40.0+10.0=50.040.0 + 10.0 = 50.0 cm3^{3}

[H+]=0.003000.0500=0.0600 mol/dm3[H^{+}] = \frac{0.00300}{0.0500} = 0.0600 \text{ mol/dm}^{3}

pH=log(0.0600)=1.22pH = -\log(0.0600) = 1.22

(b) Moles of HClHCl: 0.004000.00400 mol

Moles of NaOH: 0.100×0.0300=0.003000.100 \times 0.0300 = 0.00300 mol

HClHCl is in excess by: 0.004000.00300=0.001000.00400 - 0.00300 = 0.00100 mol

Total volume = 40.0+30.0=70.040.0 + 30.0 = 70.0 cm3^{3}

[H+]=0.001000.0700=0.01429 mol/dm3[H^{+}] = \frac{0.00100}{0.0700} = 0.01429 \text{ mol/dm}^{3}

pH=log(0.01429)=1.85pH = -\log(0.01429) = 1.85

(c) The pH changes from 1.22 to 1.85 (a change of 0.63) when NaOH added increases from 10.0 to 30.0 cm3^{3}. The change per 10 cm3^{3} is relatively small because the solution still contains a large excess of H+H^{+} (a strong acid). The pH is in the region where the logarithmic scale compresses large changes in [H+][H^{+}] into small changes in pH.

However, near the equivalence point (at 40.0 cm3^{3} of NaOH), adding even a small amount of NaOH causes a dramatic pH change because the [H+][H^{+}] approaches very small values where the logarithmic relationship amplifies the change. This is the characteristic steep region of a strong acid-strong base titration curve.


Integration Test 3: Buffer Preparation and Capacity

Question

(a) Describe how you would prepare 250 cm3^{3} of an ethanoic acid / sodium ethanoate buffer with pH = 5.00, using 0.50 mol/dm3^{3} ethanoic acid and solid sodium ethanoate (M=82.0M = 82.0 g/mol). (Ka=1.8×105K_{a} = 1.8 \times 10^{-5}) [4 marks]

(b) Calculate the mass of sodium ethanoate required. [2 marks]

(c) Explain what is meant by buffer capacity and state how it can be increased. [2 marks]


Worked Solution

(a) Using the Henderson-Hasselbalch equation:

pH=pKa+log[CH3COO][CH3COOH]pH = pK_{a} + \log\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]}

5.00=4.74+log[CH3COO][CH3COOH]5.00 = 4.74 + \log\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]}

log[CH3COO][CH3COOH]=0.26\log\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]} = 0.26

[CH3COO][CH3COOH]=100.26=1.82\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]} = 10^{0.26} = 1.82

The buffer needs [CH3COO]/[CH3COOH]=1.82[CH_{3}COO^{-}]/[CH_{3}COOH] = 1.82.

To prepare 250 cm3^{3} (0.250 dm3^{3}): choose [CH3COOH]=0.20[CH_{3}COOH] = 0.20 mol/dm3^{3} (from the 0.50 mol/dm3^{3} stock by dilution).

Volume of stock needed: V=0.20×2500.50=100V = \frac{0.20 \times 250}{0.50} = 100 cm3^{3} of 0.50 mol/dm3^{3} CH3COOHCH_{3}COOH, diluted to 250 cm3^{3}.

[CH3COO]=1.82×0.20=0.364[CH_{3}COO^{-}] = 1.82 \times 0.20 = 0.364 mol/dm3^{3}

n(CH3COO)=0.364×0.250=0.0910n(CH_{3}COO^{-}) = 0.364 \times 0.250 = 0.0910 mol

(b) m(CH3COONa)=0.0910×82.0=7.46 gm(CH_{3}COONa) = 0.0910 \times 82.0 = 7.46 \text{ g}

Procedure: Dissolve 7.46 g of sodium ethanoate in approximately 150 cm3^{3} of distilled water. Add 100 cm3^{3} of 0.50 mol/dm3^{3} ethanoic acid. Transfer to a 250 cm3^{3} volumetric flask and make up to the mark with distilled water. Mix thoroughly.

(c) Buffer capacity is the amount of strong acid or strong base that can be added to a buffer solution before the pH changes significantly (typically defined as the amount needed to change the pH by 1 unit).

Buffer capacity can be increased by:

  1. Increasing the total concentration of the weak acid and its conjugate base (higher concentrations provide more H+H^{+} or OHOH^{-} to absorb).
  2. Keeping the ratio [A]/[HA][A^{-}]/[HA] close to 1 (maximum buffer capacity occurs when pH=pKapH = pK_{a}).